About methyl (2S)-2-[[methyl(1,3-thiazol-5-ylmethyl)carbamoyl]amino]butanoate;molecular iodine
methyl (2S)-2-[[methyl(1,3-thiazol-5-ylmethyl)carbamoyl]amino]butanoate;molecular iodine (PubChem CID 91348154) has the molecular formula C11H17I2N3O3S
and a molecular weight of 525.15 g/mol. Its IUPAC name is methyl (2S)-2-[[methyl(1,3-thiazol-5-ylmethyl)carbamoyl]amino]butanoate;molecular iodine.
Molecular Properties
| Compound Name | methyl (2S)-2-[[methyl(1,3-thiazol-5-ylmethyl)carbamoyl]amino]butanoate;molecular iodine |
| PubChem CID | 91348154 |
| Molecular Formula | C11H17I2N3O3S |
| Molecular Weight | 525.15 g/mol |
| Exact Mass | 524.91 |
| IUPAC Name | methyl (2S)-2-[[methyl(1,3-thiazol-5-ylmethyl)carbamoyl]amino]butanoate;molecular iodine |
| SMILES | CC[C@H](NC(=O)N(C)Cc1cncs1)C(=O)OC.II |
| InChI | InChI=1S/C11H17N3O3S.I2/c1-4-9(10(15)17-3)13-11(16)14(2)6-8-5-12-7-18-8;1-2/h5,7,9H,4,6H2,1-3H3,(H,13,16);/t9-;/m0./s1 |
| InChIKey | IODZWUAARFRPPO-FVGYRXGTSA-N |
| XLogP | 3.01 |
| TPSA | 71.53 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 20 |
| Complexity | — |
Lipinski Rule of Five
1 violation
| Rule | Value |
| MW ≤ 500 | 525.15 |
| LogP ≤ 5 | 3.01 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'iodine', 'substructure': 'N/A'} |
|---|
Analyze methyl (2S)-2-[[methyl(1,3-thiazol-5-ylmethyl)carbamoyl]amino]butanoate;molecular iodine with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of methyl (2S)-2-[[methyl(1,3-thiazol-5-ylmethyl)carbamoyl]amino]butanoate;molecular iodine?
The IUPAC name of methyl (2S)-2-[[methyl(1,3-thiazol-5-ylmethyl)carbamoyl]amino]butanoate;molecular iodine (CID 91348154) is methyl (2S)-2-[[methyl(1,3-thiazol-5-ylmethyl)carbamoyl]amino]butanoate;molecular iodine.
What is the SMILES notation for methyl (2S)-2-[[methyl(1,3-thiazol-5-ylmethyl)carbamoyl]amino]butanoate;molecular iodine?
The canonical SMILES for methyl (2S)-2-[[methyl(1,3-thiazol-5-ylmethyl)carbamoyl]amino]butanoate;molecular iodine is CC[C@H](NC(=O)N(C)Cc1cncs1)C(=O)OC.II.
What is the InChIKey of methyl (2S)-2-[[methyl(1,3-thiazol-5-ylmethyl)carbamoyl]amino]butanoate;molecular iodine?
The InChIKey is IODZWUAARFRPPO-FVGYRXGTSA-N. The full InChI is InChI=1S/C11H17N3O3S.I2/c1-4-9(10(15)17-3)13-11(16)14(2)6-8-5-12-7-18-8;1-2/h5,7,9H,4,6H2,1-3H3,(H,13,16);/t9-;/m0./s1.
What are the key properties of methyl (2S)-2-[[methyl(1,3-thiazol-5-ylmethyl)carbamoyl]amino]butanoate;molecular iodine?
methyl (2S)-2-[[methyl(1,3-thiazol-5-ylmethyl)carbamoyl]amino]butanoate;molecular iodine has a molecular weight of 525.15 g/mol, XLogP of 3.01, 5 rotatable bonds, 1 hydrogen bond donors, and 5 hydrogen bond acceptors.
Where does this data come from?
All data for methyl (2S)-2-[[methyl(1,3-thiazol-5-ylmethyl)carbamoyl]amino]butanoate;molecular iodine is sourced from PubChem (CID 91348154), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).