About 1-(3,4-dihydro-2H-pyran-2-yl)-2-iminoethanone
1-(3,4-dihydro-2H-pyran-2-yl)-2-iminoethanone (PubChem CID 91348216) has the molecular formula C7H9NO2
and a molecular weight of 139.15 g/mol. Its IUPAC name is 1-(3,4-dihydro-2H-pyran-2-yl)-2-iminoethanone.
Molecular Properties
| Compound Name | 1-(3,4-dihydro-2H-pyran-2-yl)-2-iminoethanone |
| PubChem CID | 91348216 |
| Molecular Formula | C7H9NO2 |
| Molecular Weight | 139.15 g/mol |
| Exact Mass | 139.06 |
| IUPAC Name | 1-(3,4-dihydro-2H-pyran-2-yl)-2-iminoethanone |
| SMILES | [H]/N=C/C(=O)C1CCC=CO1 |
| InChI | InChI=1S/C7H9NO2/c8-5-6(9)7-3-1-2-4-10-7/h2,4-5,7-8H,1,3H2/b8-5+ |
| InChIKey | NYMYPBUKSVOQCW-VMPITWQZSA-N |
| XLogP | 0.90 |
| TPSA | 50.15 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 10 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 139.15 |
| LogP ≤ 5 | 0.90 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'} |
|---|
Analyze 1-(3,4-dihydro-2H-pyran-2-yl)-2-iminoethanone with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 1-(3,4-dihydro-2H-pyran-2-yl)-2-iminoethanone?
The IUPAC name of 1-(3,4-dihydro-2H-pyran-2-yl)-2-iminoethanone (CID 91348216) is 1-(3,4-dihydro-2H-pyran-2-yl)-2-iminoethanone.
What is the SMILES notation for 1-(3,4-dihydro-2H-pyran-2-yl)-2-iminoethanone?
The canonical SMILES for 1-(3,4-dihydro-2H-pyran-2-yl)-2-iminoethanone is [H]/N=C/C(=O)C1CCC=CO1.
What is the InChIKey of 1-(3,4-dihydro-2H-pyran-2-yl)-2-iminoethanone?
The InChIKey is NYMYPBUKSVOQCW-VMPITWQZSA-N. The full InChI is InChI=1S/C7H9NO2/c8-5-6(9)7-3-1-2-4-10-7/h2,4-5,7-8H,1,3H2/b8-5+.
What are the key properties of 1-(3,4-dihydro-2H-pyran-2-yl)-2-iminoethanone?
1-(3,4-dihydro-2H-pyran-2-yl)-2-iminoethanone has a molecular weight of 139.15 g/mol, XLogP of 0.90, 2 rotatable bonds, 1 hydrogen bond donors, and 3 hydrogen bond acceptors.
Where does this data come from?
All data for 1-(3,4-dihydro-2H-pyran-2-yl)-2-iminoethanone is sourced from PubChem (CID 91348216), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).