C26H30FNO4 — CID 91348320
[3-(4-fluorophenyl)-1-propan-2-ylindol-2-yl] (3S,5R)-2-ethyl-3,5-dihydroxyhept-6-enoate (PubChem CID 91348320) has the molecular formula C26H30FNO4 and a molecular weight of 439.53 g/mol. Its IUPAC name is [3-(4-fluorophenyl)-1-propan-2-ylindol-2-yl] (3S,5R)-2-ethyl-3,5-dihydroxyhept-6-enoate.
| Compound Name | [3-(4-fluorophenyl)-1-propan-2-ylindol-2-yl] (3S,5R)-2-ethyl-3,5-dihydroxyhept-6-enoate |
|---|---|
| PubChem CID | 91348320 |
| Molecular Formula | C26H30FNO4 |
| Molecular Weight | 439.53 g/mol |
| Exact Mass | 439.22 |
| IUPAC Name | [3-(4-fluorophenyl)-1-propan-2-ylindol-2-yl] (3S,5R)-2-ethyl-3,5-dihydroxyhept-6-enoate |
| SMILES | C=C[C@H](O)C[C@H](O)C(CC)C(=O)Oc1c(-c2ccc(F)cc2)c2ccccc2n1C(C)C |
| InChI | InChI=1S/C26H30FNO4/c1-5-19(29)15-23(30)20(6-2)26(31)32-25-24(17-11-13-18(27)14-12-17)21-9-7-8-10-22(21)28(25)16(3)4/h5,7-14,16,19-20,23,29-30H,1,6,15H2,2-4H3/t19-,20?,23-/m0/s1 |
| InChIKey | XWIJCFDSLKQQMX-OKVILHKKSA-N |
| XLogP | 5.26 |
| TPSA | 71.69 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 32 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 439.53 |
| LogP ≤ 5 | 5.26 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|