C9H12N2O2 — CID 91348622
8-ethyl-3,4-dihydro-2H-pyrido[3,2-b][1,4]oxazin-3-ol (PubChem CID 91348622) has the molecular formula C9H12N2O2 and a molecular weight of 180.21 g/mol. Its IUPAC name is 8-ethyl-3,4-dihydro-2H-pyrido[3,2-b][1,4]oxazin-3-ol.
| Compound Name | 8-ethyl-3,4-dihydro-2H-pyrido[3,2-b][1,4]oxazin-3-ol |
|---|---|
| PubChem CID | 91348622 |
| Molecular Formula | C9H12N2O2 |
| Molecular Weight | 180.21 g/mol |
| Exact Mass | 180.09 |
| IUPAC Name | 8-ethyl-3,4-dihydro-2H-pyrido[3,2-b][1,4]oxazin-3-ol |
| SMILES | CCc1ccnc2c1OCC(O)N2 |
| InChI | InChI=1S/C9H12N2O2/c1-2-6-3-4-10-9-8(6)13-5-7(12)11-9/h3-4,7,12H,2,5H2,1H3,(H,10,11) |
| InChIKey | MAOROPMHBQOAHL-UHFFFAOYSA-N |
| XLogP | 0.77 |
| TPSA | 54.38 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 13 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 180.21 |
| LogP ≤ 5 | 0.77 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |