C32H38 — CID 91348685
2-cycloocta-1,3-dien-1-yl-1-cycloocta-1,3,5-trien-1-yl-3-(cycloocten-1-yl)cycloocta-1,3,5,7-tetraene (PubChem CID 91348685) has the molecular formula C32H38 and a molecular weight of 422.66 g/mol. Its IUPAC name is 2-cycloocta-1,3-dien-1-yl-1-cycloocta-1,3,5-trien-1-yl-3-(cycloocten-1-yl)cycloocta-1,3,5,7-tetraene.
| Compound Name | 2-cycloocta-1,3-dien-1-yl-1-cycloocta-1,3,5-trien-1-yl-3-(cycloocten-1-yl)cycloocta-1,3,5,7-tetraene |
|---|---|
| PubChem CID | 91348685 |
| Molecular Formula | C32H38 |
| Molecular Weight | 422.66 g/mol |
| Exact Mass | 422.30 |
| IUPAC Name | 2-cycloocta-1,3-dien-1-yl-1-cycloocta-1,3,5-trien-1-yl-3-(cycloocten-1-yl)cycloocta-1,3,5,7-tetraene |
| SMILES | C1=CC=C(C2=C(C3=CC=CCCCC3)C(C3=CCCCCCC3)=CC=CC=C2)CCC=C1 |
| InChI | InChI=1S/C32H38/c1-4-11-19-27(20-12-5-1)30-25-17-10-18-26-31(28-21-13-6-2-7-14-22-28)32(30)29-23-15-8-3-9-16-24-29/h1,4-5,8,10-11,15,17-19,21,23,25-26H,2-3,6-7,9,12-14,16,20,22,24H2 |
| InChIKey | RKGRKYFACAEBMV-UHFFFAOYSA-N |
| XLogP | 9.51 |
| TPSA | 0.00 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | |
| Rotatable Bonds | 3 |
| Heavy Atoms | 32 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 422.66 |
| LogP ≤ 5 | 9.51 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 0 |