C20H22N3OS+ — CID 9134917
2-[(2R)-2-(1,3-benzothiazol-2-yl)piperidin-1-ium-1-yl]-N-phenylacetamide (PubChem CID 9134917) has the molecular formula C20H22N3OS+ and a molecular weight of 352.48 g/mol. Its IUPAC name is 2-[(2R)-2-(1,3-benzothiazol-2-yl)piperidin-1-ium-1-yl]-N-phenylacetamide.
| Compound Name | 2-[(2R)-2-(1,3-benzothiazol-2-yl)piperidin-1-ium-1-yl]-N-phenylacetamide |
|---|---|
| PubChem CID | 9134917 |
| Molecular Formula | C20H22N3OS+ |
| Molecular Weight | 352.48 g/mol |
| Exact Mass | 352.15 |
| IUPAC Name | 2-[(2R)-2-(1,3-benzothiazol-2-yl)piperidin-1-ium-1-yl]-N-phenylacetamide |
| SMILES | O=C(C[NH+]1CCCC[C@@H]1c1nc2ccccc2s1)Nc1ccccc1 |
| InChI | InChI=1S/C20H21N3OS/c24-19(21-15-8-2-1-3-9-15)14-23-13-7-6-11-17(23)20-22-16-10-4-5-12-18(16)25-20/h1-5,8-10,12,17H,6-7,11,13-14H2,(H,21,24)/p+1/t17-/m1/s1 |
| InChIKey | UEGYLOGMLHXHEN-QGZVFWFLSA-O |
| XLogP | 3.04 |
| TPSA | 46.43 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 352.48 |
| LogP ≤ 5 | 3.04 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |