C32H44N4 — CID 91349196
ethane;2,3,7,8,12,13,17,18-octamethyl-21,22,23,24-tetrahydroporphyrin (PubChem CID 91349196) has the molecular formula C32H44N4 and a molecular weight of 484.73 g/mol. Its IUPAC name is ethane;2,3,7,8,12,13,17,18-octamethyl-21,22,23,24-tetrahydroporphyrin.
| Compound Name | ethane;2,3,7,8,12,13,17,18-octamethyl-21,22,23,24-tetrahydroporphyrin |
|---|---|
| PubChem CID | 91349196 |
| Molecular Formula | C32H44N4 |
| Molecular Weight | 484.73 g/mol |
| Exact Mass | 484.36 |
| IUPAC Name | ethane;2,3,7,8,12,13,17,18-octamethyl-21,22,23,24-tetrahydroporphyrin |
| SMILES | CC.CC.Cc1c2[nH]c(c1C)C=c1[nH]c(c(C)c1C)=Cc1[nH]c(c(C)c1C)C=c1[nH]c(c(C)c1C)=C2 |
| InChI | InChI=1S/C28H32N4.2C2H6/c1-13-14(2)22-10-24-17(5)18(6)26(31-24)12-28-20(8)19(7)27(32-28)11-25-16(4)15(3)23(30-25)9-21(13)29-22;2*1-2/h9-12,29-32H,1-8H3;2*1-2H3 |
| InChIKey | PIWHFYXTRNCYHG-UHFFFAOYSA-N |
| XLogP | 5.15 |
| TPSA | 63.16 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | |
| Rotatable Bonds | |
| Heavy Atoms | 36 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 484.73 |
| LogP ≤ 5 | 5.15 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 0 |