C12H17NO7S — CID 91349351
2-(2,5-dihydroxypyrrol-1-yl)-1,8-dioxooctane-2-sulfonic acid (PubChem CID 91349351) has the molecular formula C12H17NO7S and a molecular weight of 319.33 g/mol. Its IUPAC name is 2-(2,5-dihydroxypyrrol-1-yl)-1,8-dioxooctane-2-sulfonic acid.
| Compound Name | 2-(2,5-dihydroxypyrrol-1-yl)-1,8-dioxooctane-2-sulfonic acid |
|---|---|
| PubChem CID | 91349351 |
| Molecular Formula | C12H17NO7S |
| Molecular Weight | 319.33 g/mol |
| Exact Mass | 319.07 |
| IUPAC Name | 2-(2,5-dihydroxypyrrol-1-yl)-1,8-dioxooctane-2-sulfonic acid |
| SMILES | O=CCCCCCC(C=O)(n1c(O)ccc1O)S(=O)(=O)O |
| InChI | InChI=1S/C12H17NO7S/c14-8-4-2-1-3-7-12(9-15,21(18,19)20)13-10(16)5-6-11(13)17/h5-6,8-9,16-17H,1-4,7H2,(H,18,19,20) |
| InChIKey | JMCVBSYACGGCFH-UHFFFAOYSA-N |
| XLogP | 0.79 |
| TPSA | 133.90 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 319.33 |
| LogP ≤ 5 | 0.79 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'aldehyde', 'substructure': 'N/A'}, {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'Sulfonic_acid_2', 'substructure': 'N/A'} |
|---|