C16H24OS — CID 91349422
2,2-bis(1-bicyclo[2.2.1]heptanyl)-2-sulfanylacetaldehyde (PubChem CID 91349422) has the molecular formula C16H24OS and a molecular weight of 264.43 g/mol. Its IUPAC name is 2,2-bis(1-bicyclo[2.2.1]heptanyl)-2-sulfanylacetaldehyde.
| Compound Name | 2,2-bis(1-bicyclo[2.2.1]heptanyl)-2-sulfanylacetaldehyde |
|---|---|
| PubChem CID | 91349422 |
| Molecular Formula | C16H24OS |
| Molecular Weight | 264.43 g/mol |
| Exact Mass | 264.15 |
| IUPAC Name | 2,2-bis(1-bicyclo[2.2.1]heptanyl)-2-sulfanylacetaldehyde |
| SMILES | O=CC(S)(C12CCC(CC1)C2)C12CCC(CC1)C2 |
| InChI | InChI=1S/C16H24OS/c17-11-16(18,14-5-1-12(9-14)2-6-14)15-7-3-13(10-15)4-8-15/h11-13,18H,1-10H2 |
| InChIKey | WTCXNLQFPARLGP-UHFFFAOYSA-N |
| XLogP | 4.01 |
| TPSA | 17.07 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 264.43 |
| LogP ≤ 5 | 4.01 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'aldehyde', 'substructure': 'N/A'}, {'alert_name': 'thiol_2', 'substructure': 'N/A'} |
|---|