C32H39FN4O8 — CID 91349631
2-[[4-(dimethylamino)-4-phenylcyclohexyl]methyl-[2-(5-fluoro-1H-indol-3-yl)ethylcarbamoyl]amino]oxypropane-1,2,3-tricarboxylic acid (PubChem CID 91349631) has the molecular formula C32H39FN4O8 and a molecular weight of 626.68 g/mol. Its IUPAC name is 2-[[4-(dimethylamino)-4-phenylcyclohexyl]methyl-[2-(5-fluoro-1H-indol-3-yl)ethylcarbamoyl]amino]oxypropane-1,2,3-tricarboxylic acid.
| Compound Name | 2-[[4-(dimethylamino)-4-phenylcyclohexyl]methyl-[2-(5-fluoro-1H-indol-3-yl)ethylcarbamoyl]amino]oxypropane-1,2,3-tricarboxylic acid |
|---|---|
| PubChem CID | 91349631 |
| Molecular Formula | C32H39FN4O8 |
| Molecular Weight | 626.68 g/mol |
| Exact Mass | 626.28 |
| IUPAC Name | 2-[[4-(dimethylamino)-4-phenylcyclohexyl]methyl-[2-(5-fluoro-1H-indol-3-yl)ethylcarbamoyl]amino]oxypropane-1,2,3-tricarboxylic acid |
| SMILES | CN(C)C1(c2ccccc2)CCC(CN(OC(CC(=O)O)(CC(=O)O)C(=O)O)C(=O)NCCc2c[nH]c3ccc(F)cc23)CC1 |
| InChI | InChI=1S/C32H39FN4O8/c1-36(2)31(23-6-4-3-5-7-23)13-10-21(11-14-31)20-37(45-32(29(42)43,17-27(38)39)18-28(40)41)30(44)34-15-12-22-19-35-26-9-8-24(33)16-25(22)26/h3-9,16,19,21,35H,10-15,17-18,20H2,1-2H3,(H,34,44)(H,38,39)(H,40,41)(H,42,43) |
| InChIKey | KAYXVPPDVLVGBG-UHFFFAOYSA-N |
| XLogP | 4.21 |
| TPSA | 172.50 Ų |
| H-Bond Donors | 5 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 14 |
| Heavy Atoms | 45 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 626.68 |
| LogP ≤ 5 | 4.21 |
| H-Bond Donors ≤ 5 | 5 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|