About ethane;methyl 2-(benzylamino)propanoate
ethane;methyl 2-(benzylamino)propanoate (PubChem CID 91349755) has the molecular formula C13H21NO2
and a molecular weight of 223.32 g/mol. Its IUPAC name is ethane;methyl 2-(benzylamino)propanoate.
Molecular Properties
| Compound Name | ethane;methyl 2-(benzylamino)propanoate |
| PubChem CID | 91349755 |
| Molecular Formula | C13H21NO2 |
| Molecular Weight | 223.32 g/mol |
| Exact Mass | 223.16 |
| IUPAC Name | ethane;methyl 2-(benzylamino)propanoate |
| SMILES | CC.COC(=O)C(C)NCc1ccccc1 |
| InChI | InChI=1S/C11H15NO2.C2H6/c1-9(11(13)14-2)12-8-10-6-4-3-5-7-10;1-2/h3-7,9,12H,8H2,1-2H3;1-2H3 |
| InChIKey | YJBFTSDNAVJAHC-UHFFFAOYSA-N |
| XLogP | 2.36 |
| TPSA | 38.33 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 16 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 223.32 |
| LogP ≤ 5 | 2.36 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
Analyze ethane;methyl 2-(benzylamino)propanoate with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of ethane;methyl 2-(benzylamino)propanoate?
The IUPAC name of ethane;methyl 2-(benzylamino)propanoate (CID 91349755) is ethane;methyl 2-(benzylamino)propanoate.
What is the SMILES notation for ethane;methyl 2-(benzylamino)propanoate?
The canonical SMILES for ethane;methyl 2-(benzylamino)propanoate is CC.COC(=O)C(C)NCc1ccccc1.
What is the InChIKey of ethane;methyl 2-(benzylamino)propanoate?
The InChIKey is YJBFTSDNAVJAHC-UHFFFAOYSA-N. The full InChI is InChI=1S/C11H15NO2.C2H6/c1-9(11(13)14-2)12-8-10-6-4-3-5-7-10;1-2/h3-7,9,12H,8H2,1-2H3;1-2H3.
What are the key properties of ethane;methyl 2-(benzylamino)propanoate?
ethane;methyl 2-(benzylamino)propanoate has a molecular weight of 223.32 g/mol, XLogP of 2.36, 4 rotatable bonds, 1 hydrogen bond donors, and 3 hydrogen bond acceptors.
Where does this data come from?
All data for ethane;methyl 2-(benzylamino)propanoate is sourced from PubChem (CID 91349755), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).