C20H34 — CID 91349857
3-(1-cyclohexylethyl)-1,2,3,3a,4,5,5a,6,7,8,8a,8b-dodecahydroacenaphthylene (PubChem CID 91349857) has the molecular formula C20H34 and a molecular weight of 274.49 g/mol. Its IUPAC name is 3-(1-cyclohexylethyl)-1,2,3,3a,4,5,5a,6,7,8,8a,8b-dodecahydroacenaphthylene.
| Compound Name | 3-(1-cyclohexylethyl)-1,2,3,3a,4,5,5a,6,7,8,8a,8b-dodecahydroacenaphthylene |
|---|---|
| PubChem CID | 91349857 |
| Molecular Formula | C20H34 |
| Molecular Weight | 274.49 g/mol |
| Exact Mass | 274.27 |
| IUPAC Name | 3-(1-cyclohexylethyl)-1,2,3,3a,4,5,5a,6,7,8,8a,8b-dodecahydroacenaphthylene |
| SMILES | CC(C1CCCCC1)C1CCC2CCCC3CCC1C23 |
| InChI | InChI=1S/C20H34/c1-14(15-6-3-2-4-7-15)18-12-10-16-8-5-9-17-11-13-19(18)20(16)17/h14-20H,2-13H2,1H3 |
| InChIKey | OLPBHHIDNFRDQR-UHFFFAOYSA-N |
| XLogP | 6.06 |
| TPSA | 0.00 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | |
| Rotatable Bonds | 2 |
| Heavy Atoms | 20 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 274.49 |
| LogP ≤ 5 | 6.06 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 0 |