C25H31N3O4 — CID 91350018
propan-2-yl N-[4-[1-cyclobutyl-6-ethoxy-3-(methoxyamino)indol-2-yl]phenyl]carbamate (PubChem CID 91350018) has the molecular formula C25H31N3O4 and a molecular weight of 437.54 g/mol. Its IUPAC name is propan-2-yl N-[4-[1-cyclobutyl-6-ethoxy-3-(methoxyamino)indol-2-yl]phenyl]carbamate.
| Compound Name | propan-2-yl N-[4-[1-cyclobutyl-6-ethoxy-3-(methoxyamino)indol-2-yl]phenyl]carbamate |
|---|---|
| PubChem CID | 91350018 |
| Molecular Formula | C25H31N3O4 |
| Molecular Weight | 437.54 g/mol |
| Exact Mass | 437.23 |
| IUPAC Name | propan-2-yl N-[4-[1-cyclobutyl-6-ethoxy-3-(methoxyamino)indol-2-yl]phenyl]carbamate |
| SMILES | CCOc1ccc2c(NOC)c(-c3ccc(NC(=O)OC(C)C)cc3)n(C3CCC3)c2c1 |
| InChI | InChI=1S/C25H31N3O4/c1-5-31-20-13-14-21-22(15-20)28(19-7-6-8-19)24(23(21)27-30-4)17-9-11-18(12-10-17)26-25(29)32-16(2)3/h9-16,19,27H,5-8H2,1-4H3,(H,26,29) |
| InChIKey | OLPWGKYNULKNIS-UHFFFAOYSA-N |
| XLogP | 6.36 |
| TPSA | 73.75 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 32 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 437.54 |
| LogP ≤ 5 | 6.36 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|