About 1,2-dimethyl-1,3-thiazol-1-ium
1,2-dimethyl-1,3-thiazol-1-ium (PubChem CID 91350460) has the molecular formula C5H8NS+
and a molecular weight of 114.19 g/mol. Its IUPAC name is 1,2-dimethyl-1,3-thiazol-1-ium.
Molecular Properties
| Compound Name | 1,2-dimethyl-1,3-thiazol-1-ium |
| PubChem CID | 91350460 |
| Molecular Formula | C5H8NS+ |
| Molecular Weight | 114.19 g/mol |
| Exact Mass | 114.04 |
| IUPAC Name | 1,2-dimethyl-1,3-thiazol-1-ium |
| SMILES | Cc1ncc[s+]1C |
| InChI | InChI=1S/C5H8NS/c1-5-6-3-4-7(5)2/h3-4H,1-2H3/q+1 |
| InChIKey | AEGJIDJYXSUSMM-UHFFFAOYSA-N |
| XLogP | 1.68 |
| TPSA | 12.89 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | |
| Heavy Atoms | 7 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 114.19 |
| LogP ≤ 5 | 1.68 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 1 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'charged_oxygen_or_sulfur_atoms', 'substructure': 'N/A'} |
|---|
Analyze 1,2-dimethyl-1,3-thiazol-1-ium with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 1,2-dimethyl-1,3-thiazol-1-ium?
The IUPAC name of 1,2-dimethyl-1,3-thiazol-1-ium (CID 91350460) is 1,2-dimethyl-1,3-thiazol-1-ium.
What is the SMILES notation for 1,2-dimethyl-1,3-thiazol-1-ium?
The canonical SMILES for 1,2-dimethyl-1,3-thiazol-1-ium is Cc1ncc[s+]1C.
What is the InChIKey of 1,2-dimethyl-1,3-thiazol-1-ium?
The InChIKey is AEGJIDJYXSUSMM-UHFFFAOYSA-N. The full InChI is InChI=1S/C5H8NS/c1-5-6-3-4-7(5)2/h3-4H,1-2H3/q+1.
What are the key properties of 1,2-dimethyl-1,3-thiazol-1-ium?
1,2-dimethyl-1,3-thiazol-1-ium has a molecular weight of 114.19 g/mol, XLogP of 1.68, 0 rotatable bonds, 0 hydrogen bond donors, and 1 hydrogen bond acceptors.
Where does this data come from?
All data for 1,2-dimethyl-1,3-thiazol-1-ium is sourced from PubChem (CID 91350460), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).