C14H22F3O+ — CID 91350646
(Z,5Z)-1,1,1-trifluoro-5-(2-methoxyethylidene)-2,6,7-trimethyloct-3-ene (PubChem CID 91350646) has the molecular formula C14H22F3O+ and a molecular weight of 263.32 g/mol. Its IUPAC name is (Z,5Z)-1,1,1-trifluoro-5-(2-methoxyethylidene)-2,6,7-trimethyloct-3-ene.
| Compound Name | (Z,5Z)-1,1,1-trifluoro-5-(2-methoxyethylidene)-2,6,7-trimethyloct-3-ene |
|---|---|
| PubChem CID | 91350646 |
| Molecular Formula | C14H22F3O+ |
| Molecular Weight | 263.32 g/mol |
| Exact Mass | 263.16 |
| IUPAC Name | (Z,5Z)-1,1,1-trifluoro-5-(2-methoxyethylidene)-2,6,7-trimethyloct-3-ene |
| SMILES | COC/C=C(\C=C/C(C)C(F)(F)F)C(C)[C+](C)C |
| InChI | InChI=1S/C14H22F3O/c1-10(2)12(4)13(8-9-18-5)7-6-11(3)14(15,16)17/h6-8,11-12H,9H2,1-5H3/q+1/b7-6-,13-8+ |
| InChIKey | HIJAWQOYCVSDFD-ONVRAGQBSA-N |
| XLogP | 4.56 |
| TPSA | 9.23 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 263.32 |
| LogP ≤ 5 | 4.56 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 1 |
| Structural Alerts | {'alert_name': 'Carbo_cation/anion', 'substructure': 'N/A'}, {'alert_name': 'polyene', 'substructure': 'N/A'} |
|---|