C21H27NO12S — CID 91350888
(2,5-dihydroxypyrrol-1-yl) 3-[(3S,4R,5S,6R)-3,4,5-triacetyloxy-6-(acetyloxymethyl)thian-2-yl]propanoate (PubChem CID 91350888) has the molecular formula C21H27NO12S and a molecular weight of 517.51 g/mol. Its IUPAC name is (2,5-dihydroxypyrrol-1-yl) 3-[(3S,4R,5S,6R)-3,4,5-triacetyloxy-6-(acetyloxymethyl)thian-2-yl]propanoate.
| Compound Name | (2,5-dihydroxypyrrol-1-yl) 3-[(3S,4R,5S,6R)-3,4,5-triacetyloxy-6-(acetyloxymethyl)thian-2-yl]propanoate |
|---|---|
| PubChem CID | 91350888 |
| Molecular Formula | C21H27NO12S |
| Molecular Weight | 517.51 g/mol |
| Exact Mass | 517.13 |
| IUPAC Name | (2,5-dihydroxypyrrol-1-yl) 3-[(3S,4R,5S,6R)-3,4,5-triacetyloxy-6-(acetyloxymethyl)thian-2-yl]propanoate |
| SMILES | CC(=O)OC[C@H]1SC(CCC(=O)On2c(O)ccc2O)[C@@H](OC(C)=O)[C@@H](OC(C)=O)[C@@H]1OC(C)=O |
| InChI | InChI=1S/C21H27NO12S/c1-10(23)30-9-15-20(32-12(3)25)21(33-13(4)26)19(31-11(2)24)14(35-15)5-8-18(29)34-22-16(27)6-7-17(22)28/h6-7,14-15,19-21,27-28H,5,8-9H2,1-4H3/t14?,15-,19-,20-,21-/m1/s1 |
| InChIKey | BNZRQIZFBLLNIQ-YMDVBDDVSA-N |
| XLogP | 0.48 |
| TPSA | 176.89 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 14 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 35 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 517.51 |
| LogP ≤ 5 | 0.48 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 14 |
| Structural Alerts | {'alert_name': '>_2_ester_groups', 'substructure': 'N/A'} |
|---|