C27H54N2O6 — CID 91350982
1-methoxy-3-(1,2,2,6,6-pentamethylpiperidin-4-yl)oxypropan-2-ol;methyl 2-(1,2,2,6,6-pentamethylpiperidin-4-yl)oxyacetate (PubChem CID 91350982) has the molecular formula C27H54N2O6 and a molecular weight of 502.74 g/mol. Its IUPAC name is 1-methoxy-3-(1,2,2,6,6-pentamethylpiperidin-4-yl)oxypropan-2-ol;methyl 2-(1,2,2,6,6-pentamethylpiperidin-4-yl)oxyacetate.
| Compound Name | 1-methoxy-3-(1,2,2,6,6-pentamethylpiperidin-4-yl)oxypropan-2-ol;methyl 2-(1,2,2,6,6-pentamethylpiperidin-4-yl)oxyacetate |
|---|---|
| PubChem CID | 91350982 |
| Molecular Formula | C27H54N2O6 |
| Molecular Weight | 502.74 g/mol |
| Exact Mass | 502.40 |
| IUPAC Name | 1-methoxy-3-(1,2,2,6,6-pentamethylpiperidin-4-yl)oxypropan-2-ol;methyl 2-(1,2,2,6,6-pentamethylpiperidin-4-yl)oxyacetate |
| SMILES | COC(=O)COC1CC(C)(C)N(C)C(C)(C)C1.COCC(O)COC1CC(C)(C)N(C)C(C)(C)C1 |
| InChI | InChI=1S/C14H29NO3.C13H25NO3/c1-13(2)7-12(8-14(3,4)15(13)5)18-10-11(16)9-17-6;1-12(2)7-10(17-9-11(15)16-6)8-13(3,4)14(12)5/h11-12,16H,7-10H2,1-6H3;10H,7-9H2,1-6H3 |
| InChIKey | HUVHFHJIUDULHO-UHFFFAOYSA-N |
| XLogP | 3.49 |
| TPSA | 80.70 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 35 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 502.74 |
| LogP ≤ 5 | 3.49 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 8 |