C21H34N2O4Si — CID 91351056
(3S,4S)-3-[(1S)-1-[tert-butyl(dimethyl)silyl]oxyethyl]-4-(2-ethyl-1,3-dihydroxy-4,7-dihydroisoindol-5-yl)azetidin-2-one (PubChem CID 91351056) has the molecular formula C21H34N2O4Si and a molecular weight of 406.60 g/mol. Its IUPAC name is (3S,4S)-3-[(1S)-1-[tert-butyl(dimethyl)silyl]oxyethyl]-4-(2-ethyl-1,3-dihydroxy-4,7-dihydroisoindol-5-yl)azetidin-2-one.
| Compound Name | (3S,4S)-3-[(1S)-1-[tert-butyl(dimethyl)silyl]oxyethyl]-4-(2-ethyl-1,3-dihydroxy-4,7-dihydroisoindol-5-yl)azetidin-2-one |
|---|---|
| PubChem CID | 91351056 |
| Molecular Formula | C21H34N2O4Si |
| Molecular Weight | 406.60 g/mol |
| Exact Mass | 406.23 |
| IUPAC Name | (3S,4S)-3-[(1S)-1-[tert-butyl(dimethyl)silyl]oxyethyl]-4-(2-ethyl-1,3-dihydroxy-4,7-dihydroisoindol-5-yl)azetidin-2-one |
| SMILES | CCn1c(O)c2c(c1O)CC([C@H]1NC(=O)[C@@H]1[C@H](C)O[Si](C)(C)C(C)(C)C)=CC2 |
| InChI | InChI=1S/C21H34N2O4Si/c1-8-23-19(25)14-10-9-13(11-15(14)20(23)26)17-16(18(24)22-17)12(2)27-28(6,7)21(3,4)5/h9,12,16-17,25-26H,8,10-11H2,1-7H3,(H,22,24)/t12-,16+,17+/m0/s1 |
| InChIKey | KOISRTNWPPDINT-JCURWCKSSA-N |
| XLogP | 3.47 |
| TPSA | 83.72 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 28 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 406.60 |
| LogP ≤ 5 | 3.47 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|