C10H21N3O2 — CID 91351399
1-[1-(2-hydroxyethyl)piperidin-4-yl]-1,3-dimethylurea (PubChem CID 91351399) has the molecular formula C10H21N3O2 and a molecular weight of 215.30 g/mol. Its IUPAC name is 1-[1-(2-hydroxyethyl)piperidin-4-yl]-1,3-dimethylurea.
| Compound Name | 1-[1-(2-hydroxyethyl)piperidin-4-yl]-1,3-dimethylurea |
|---|---|
| PubChem CID | 91351399 |
| Molecular Formula | C10H21N3O2 |
| Molecular Weight | 215.30 g/mol |
| Exact Mass | 215.16 |
| IUPAC Name | 1-[1-(2-hydroxyethyl)piperidin-4-yl]-1,3-dimethylurea |
| SMILES | CNC(=O)N(C)C1CCN(CCO)CC1 |
| InChI | InChI=1S/C10H21N3O2/c1-11-10(15)12(2)9-3-5-13(6-4-9)7-8-14/h9,14H,3-8H2,1-2H3,(H,11,15) |
| InChIKey | NDPMRNQWETVRRU-UHFFFAOYSA-N |
| XLogP | -0.29 |
| TPSA | 55.81 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 15 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 215.30 |
| LogP ≤ 5 | -0.29 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |