C28H31F3N4O4 — CID 91351452
6-cyclopentyl-3-[(5,7-dimethyl-[1,2,4]triazolo[1,5-a]pyrimidin-2-yl)methyl]-6-[2-[4-hydroxy-3-(2,2,2-trifluoroethyl)phenyl]ethyl]oxane-2,4-dione (PubChem CID 91351452) has the molecular formula C28H31F3N4O4 and a molecular weight of 544.57 g/mol. Its IUPAC name is 6-cyclopentyl-3-[(5,7-dimethyl-[1,2,4]triazolo[1,5-a]pyrimidin-2-yl)methyl]-6-[2-[4-hydroxy-3-(2,2,2-trifluoroethyl)phenyl]ethyl]oxane-2,4-dione.
| Compound Name | 6-cyclopentyl-3-[(5,7-dimethyl-[1,2,4]triazolo[1,5-a]pyrimidin-2-yl)methyl]-6-[2-[4-hydroxy-3-(2,2,2-trifluoroethyl)phenyl]ethyl]oxane-2,4-dione |
|---|---|
| PubChem CID | 91351452 |
| Molecular Formula | C28H31F3N4O4 |
| Molecular Weight | 544.57 g/mol |
| Exact Mass | 544.23 |
| IUPAC Name | 6-cyclopentyl-3-[(5,7-dimethyl-[1,2,4]triazolo[1,5-a]pyrimidin-2-yl)methyl]-6-[2-[4-hydroxy-3-(2,2,2-trifluoroethyl)phenyl]ethyl]oxane-2,4-dione |
| SMILES | Cc1cc(C)n2nc(CC3C(=O)CC(CCc4ccc(O)c(CC(F)(F)F)c4)(C4CCCC4)OC3=O)nc2n1 |
| InChI | InChI=1S/C28H31F3N4O4/c1-16-11-17(2)35-26(32-16)33-24(34-35)13-21-23(37)15-27(39-25(21)38,20-5-3-4-6-20)10-9-18-7-8-22(36)19(12-18)14-28(29,30)31/h7-8,11-12,20-21,36H,3-6,9-10,13-15H2,1-2H3 |
| InChIKey | JPTYOXZFSJAQKZ-UHFFFAOYSA-N |
| XLogP | 4.79 |
| TPSA | 106.68 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 39 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 544.57 |
| LogP ≤ 5 | 4.79 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'beta-keto/anhydride', 'substructure': 'N/A'} |
|---|