C20H18F3N3OS — CID 9135150
2-[(2R)-2-(1,3-benzothiazol-2-yl)piperidin-1-yl]-N-(2,3,4-trifluorophenyl)acetamide (PubChem CID 9135150) has the molecular formula C20H18F3N3OS and a molecular weight of 405.45 g/mol. Its IUPAC name is 2-[(2R)-2-(1,3-benzothiazol-2-yl)piperidin-1-yl]-N-(2,3,4-trifluorophenyl)acetamide.
| Compound Name | 2-[(2R)-2-(1,3-benzothiazol-2-yl)piperidin-1-yl]-N-(2,3,4-trifluorophenyl)acetamide |
|---|---|
| PubChem CID | 9135150 |
| Molecular Formula | C20H18F3N3OS |
| Molecular Weight | 405.45 g/mol |
| Exact Mass | 405.11 |
| IUPAC Name | 2-[(2R)-2-(1,3-benzothiazol-2-yl)piperidin-1-yl]-N-(2,3,4-trifluorophenyl)acetamide |
| SMILES | O=C(CN1CCCC[C@@H]1c1nc2ccccc2s1)Nc1ccc(F)c(F)c1F |
| InChI | InChI=1S/C20H18F3N3OS/c21-12-8-9-14(19(23)18(12)22)24-17(27)11-26-10-4-3-6-15(26)20-25-13-5-1-2-7-16(13)28-20/h1-2,5,7-9,15H,3-4,6,10-11H2,(H,24,27)/t15-/m1/s1 |
| InChIKey | HSAOFIXURANZMX-OAHLLOKOSA-N |
| XLogP | 4.88 |
| TPSA | 45.23 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 28 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 405.45 |
| LogP ≤ 5 | 4.88 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'halogenated_ring_2', 'substructure': 'N/A'} |
|---|