About 2-ethyl-1,1-dimethyl-3-(2-methylprop-1-enyl)cyclopropane;1-ethyl-4-methylcyclohexane
2-ethyl-1,1-dimethyl-3-(2-methylprop-1-enyl)cyclopropane;1-ethyl-4-methylcyclohexane (PubChem CID 91351798) has the molecular formula C20H38
and a molecular weight of 278.52 g/mol. Its IUPAC name is 2-ethyl-1,1-dimethyl-3-(2-methylprop-1-enyl)cyclopropane;1-ethyl-4-methylcyclohexane.
Molecular Properties
| Compound Name | 2-ethyl-1,1-dimethyl-3-(2-methylprop-1-enyl)cyclopropane;1-ethyl-4-methylcyclohexane |
| PubChem CID | 91351798 |
| Molecular Formula | C20H38 |
| Molecular Weight | 278.52 g/mol |
| Exact Mass | 278.30 |
| IUPAC Name | 2-ethyl-1,1-dimethyl-3-(2-methylprop-1-enyl)cyclopropane;1-ethyl-4-methylcyclohexane |
| SMILES | CCC1C(C=C(C)C)C1(C)C.CCC1CCC(C)CC1 |
| InChI | InChI=1S/C11H20.C9H18/c1-6-9-10(7-8(2)3)11(9,4)5;1-3-9-6-4-8(2)5-7-9/h7,9-10H,6H2,1-5H3;8-9H,3-7H2,1-2H3 |
| InChIKey | HCGICBGYMDLGRA-UHFFFAOYSA-N |
| XLogP | 6.86 |
| TPSA | 0.00 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | |
| Rotatable Bonds | 3 |
| Heavy Atoms | 20 |
| Complexity | — |
Lipinski Rule of Five
1 violation
| Rule | Value |
| MW ≤ 500 | 278.52 |
| LogP ≤ 5 | 6.86 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 0 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|
Analyze 2-ethyl-1,1-dimethyl-3-(2-methylprop-1-enyl)cyclopropane;1-ethyl-4-methylcyclohexane with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 2-ethyl-1,1-dimethyl-3-(2-methylprop-1-enyl)cyclopropane;1-ethyl-4-methylcyclohexane?
The IUPAC name of 2-ethyl-1,1-dimethyl-3-(2-methylprop-1-enyl)cyclopropane;1-ethyl-4-methylcyclohexane (CID 91351798) is 2-ethyl-1,1-dimethyl-3-(2-methylprop-1-enyl)cyclopropane;1-ethyl-4-methylcyclohexane.
What is the SMILES notation for 2-ethyl-1,1-dimethyl-3-(2-methylprop-1-enyl)cyclopropane;1-ethyl-4-methylcyclohexane?
The canonical SMILES for 2-ethyl-1,1-dimethyl-3-(2-methylprop-1-enyl)cyclopropane;1-ethyl-4-methylcyclohexane is CCC1C(C=C(C)C)C1(C)C.CCC1CCC(C)CC1.
What is the InChIKey of 2-ethyl-1,1-dimethyl-3-(2-methylprop-1-enyl)cyclopropane;1-ethyl-4-methylcyclohexane?
The InChIKey is HCGICBGYMDLGRA-UHFFFAOYSA-N. The full InChI is InChI=1S/C11H20.C9H18/c1-6-9-10(7-8(2)3)11(9,4)5;1-3-9-6-4-8(2)5-7-9/h7,9-10H,6H2,1-5H3;8-9H,3-7H2,1-2H3.
What are the key properties of 2-ethyl-1,1-dimethyl-3-(2-methylprop-1-enyl)cyclopropane;1-ethyl-4-methylcyclohexane?
2-ethyl-1,1-dimethyl-3-(2-methylprop-1-enyl)cyclopropane;1-ethyl-4-methylcyclohexane has a molecular weight of 278.52 g/mol, XLogP of 6.86, 3 rotatable bonds, 0 hydrogen bond donors, and 0 hydrogen bond acceptors.
Where does this data come from?
All data for 2-ethyl-1,1-dimethyl-3-(2-methylprop-1-enyl)cyclopropane;1-ethyl-4-methylcyclohexane is sourced from PubChem (CID 91351798), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).