About ethane;2-methylideneimidazo[1,2-a]pyridin-3-one
ethane;2-methylideneimidazo[1,2-a]pyridin-3-one (PubChem CID 91352293) has the molecular formula C10H12N2O
and a molecular weight of 176.22 g/mol. Its IUPAC name is ethane;2-methylideneimidazo[1,2-a]pyridin-3-one.
Molecular Properties
| Compound Name | ethane;2-methylideneimidazo[1,2-a]pyridin-3-one |
| PubChem CID | 91352293 |
| Molecular Formula | C10H12N2O |
| Molecular Weight | 176.22 g/mol |
| Exact Mass | 176.09 |
| IUPAC Name | ethane;2-methylideneimidazo[1,2-a]pyridin-3-one |
| SMILES | C=C1N=C2C=CC=CN2C1=O.CC |
| InChI | InChI=1S/C8H6N2O.C2H6/c1-6-8(11)10-5-3-2-4-7(10)9-6;1-2/h2-5H,1H2;1-2H3 |
| InChIKey | XPLXNFUVVSSJDI-UHFFFAOYSA-N |
| XLogP | 1.85 |
| TPSA | 32.67 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | |
| Heavy Atoms | 13 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 176.22 |
| LogP ≤ 5 | 1.85 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|
Analyze ethane;2-methylideneimidazo[1,2-a]pyridin-3-one with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of ethane;2-methylideneimidazo[1,2-a]pyridin-3-one?
The IUPAC name of ethane;2-methylideneimidazo[1,2-a]pyridin-3-one (CID 91352293) is ethane;2-methylideneimidazo[1,2-a]pyridin-3-one.
What is the SMILES notation for ethane;2-methylideneimidazo[1,2-a]pyridin-3-one?
The canonical SMILES for ethane;2-methylideneimidazo[1,2-a]pyridin-3-one is C=C1N=C2C=CC=CN2C1=O.CC.
What is the InChIKey of ethane;2-methylideneimidazo[1,2-a]pyridin-3-one?
The InChIKey is XPLXNFUVVSSJDI-UHFFFAOYSA-N. The full InChI is InChI=1S/C8H6N2O.C2H6/c1-6-8(11)10-5-3-2-4-7(10)9-6;1-2/h2-5H,1H2;1-2H3.
What are the key properties of ethane;2-methylideneimidazo[1,2-a]pyridin-3-one?
ethane;2-methylideneimidazo[1,2-a]pyridin-3-one has a molecular weight of 176.22 g/mol, XLogP of 1.85, 0 rotatable bonds, 0 hydrogen bond donors, and 2 hydrogen bond acceptors.
Where does this data come from?
All data for ethane;2-methylideneimidazo[1,2-a]pyridin-3-one is sourced from PubChem (CID 91352293), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).