C6H7ClN2S2 — CID 91352836
6-chloro-4-methyl-2,3-dihydrothieno[3,2-e][1,2,4]thiadiazine (PubChem CID 91352836) has the molecular formula C6H7ClN2S2 and a molecular weight of 206.72 g/mol. Its IUPAC name is 6-chloro-4-methyl-2,3-dihydrothieno[3,2-e][1,2,4]thiadiazine.
| Compound Name | 6-chloro-4-methyl-2,3-dihydrothieno[3,2-e][1,2,4]thiadiazine |
|---|---|
| PubChem CID | 91352836 |
| Molecular Formula | C6H7ClN2S2 |
| Molecular Weight | 206.72 g/mol |
| Exact Mass | 205.97 |
| IUPAC Name | 6-chloro-4-methyl-2,3-dihydrothieno[3,2-e][1,2,4]thiadiazine |
| SMILES | CN1CNSc2sc(Cl)cc21 |
| InChI | InChI=1S/C6H7ClN2S2/c1-9-3-8-11-6-4(9)2-5(7)10-6/h2,8H,3H2,1H3 |
| InChIKey | UXXBOHLCSPBEBK-UHFFFAOYSA-N |
| XLogP | 2.41 |
| TPSA | 15.27 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | |
| Heavy Atoms | 11 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 206.72 |
| LogP ≤ 5 | 2.41 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'sulphur_nitrogen_single_bond', 'substructure': 'N/A'} |
|---|