About 5-methyl-2,5-dihydro-1H-pyrimidin-6-one
5-methyl-2,5-dihydro-1H-pyrimidin-6-one (PubChem CID 91352941) has the molecular formula C5H8N2O
and a molecular weight of 112.13 g/mol. Its IUPAC name is 5-methyl-2,5-dihydro-1H-pyrimidin-6-one.
Molecular Properties
| Compound Name | 5-methyl-2,5-dihydro-1H-pyrimidin-6-one |
| PubChem CID | 91352941 |
| Molecular Formula | C5H8N2O |
| Molecular Weight | 112.13 g/mol |
| Exact Mass | 112.06 |
| IUPAC Name | 5-methyl-2,5-dihydro-1H-pyrimidin-6-one |
| SMILES | CC1C=NCNC1=O |
| InChI | InChI=1S/C5H8N2O/c1-4-2-6-3-7-5(4)8/h2,4H,3H2,1H3,(H,7,8) |
| InChIKey | NHNCPEOPUQONSL-UHFFFAOYSA-N |
| XLogP | -0.22 |
| TPSA | 41.46 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | |
| Heavy Atoms | 8 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 112.13 |
| LogP ≤ 5 | -0.22 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |
Analyze 5-methyl-2,5-dihydro-1H-pyrimidin-6-one with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 5-methyl-2,5-dihydro-1H-pyrimidin-6-one?
The IUPAC name of 5-methyl-2,5-dihydro-1H-pyrimidin-6-one (CID 91352941) is 5-methyl-2,5-dihydro-1H-pyrimidin-6-one.
What is the SMILES notation for 5-methyl-2,5-dihydro-1H-pyrimidin-6-one?
The canonical SMILES for 5-methyl-2,5-dihydro-1H-pyrimidin-6-one is CC1C=NCNC1=O.
What is the InChIKey of 5-methyl-2,5-dihydro-1H-pyrimidin-6-one?
The InChIKey is NHNCPEOPUQONSL-UHFFFAOYSA-N. The full InChI is InChI=1S/C5H8N2O/c1-4-2-6-3-7-5(4)8/h2,4H,3H2,1H3,(H,7,8).
What are the key properties of 5-methyl-2,5-dihydro-1H-pyrimidin-6-one?
5-methyl-2,5-dihydro-1H-pyrimidin-6-one has a molecular weight of 112.13 g/mol, XLogP of -0.22, 0 rotatable bonds, 1 hydrogen bond donors, and 2 hydrogen bond acceptors.
Where does this data come from?
All data for 5-methyl-2,5-dihydro-1H-pyrimidin-6-one is sourced from PubChem (CID 91352941), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).