C20H20N4O3S — CID 9135297
2-[(2S)-2-(1,3-benzothiazol-2-yl)piperidin-1-yl]-N-(4-nitrophenyl)acetamide (PubChem CID 9135297) has the molecular formula C20H20N4O3S and a molecular weight of 396.47 g/mol. Its IUPAC name is 2-[(2S)-2-(1,3-benzothiazol-2-yl)piperidin-1-yl]-N-(4-nitrophenyl)acetamide.
| Compound Name | 2-[(2S)-2-(1,3-benzothiazol-2-yl)piperidin-1-yl]-N-(4-nitrophenyl)acetamide |
|---|---|
| PubChem CID | 9135297 |
| Molecular Formula | C20H20N4O3S |
| Molecular Weight | 396.47 g/mol |
| Exact Mass | 396.13 |
| IUPAC Name | 2-[(2S)-2-(1,3-benzothiazol-2-yl)piperidin-1-yl]-N-(4-nitrophenyl)acetamide |
| SMILES | O=C(CN1CCCC[C@H]1c1nc2ccccc2s1)Nc1ccc([N+](=O)[O-])cc1 |
| InChI | InChI=1S/C20H20N4O3S/c25-19(21-14-8-10-15(11-9-14)24(26)27)13-23-12-4-3-6-17(23)20-22-16-5-1-2-7-18(16)28-20/h1-2,5,7-11,17H,3-4,6,12-13H2,(H,21,25)/t17-/m0/s1 |
| InChIKey | RTDYFFUVNVVFFX-KRWDZBQOSA-N |
| XLogP | 4.37 |
| TPSA | 88.37 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 28 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 396.47 |
| LogP ≤ 5 | 4.37 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|