C21H43FN2 — CID 91353599
7-N-ethyl-3-fluoro-4,4,12-trimethyl-8-propan-2-yltridec-1-ene-5,7-diamine (PubChem CID 91353599) has the molecular formula C21H43FN2 and a molecular weight of 342.59 g/mol. Its IUPAC name is 7-N-ethyl-3-fluoro-4,4,12-trimethyl-8-propan-2-yltridec-1-ene-5,7-diamine.
| Compound Name | 7-N-ethyl-3-fluoro-4,4,12-trimethyl-8-propan-2-yltridec-1-ene-5,7-diamine |
|---|---|
| PubChem CID | 91353599 |
| Molecular Formula | C21H43FN2 |
| Molecular Weight | 342.59 g/mol |
| Exact Mass | 342.34 |
| IUPAC Name | 7-N-ethyl-3-fluoro-4,4,12-trimethyl-8-propan-2-yltridec-1-ene-5,7-diamine |
| SMILES | C=CC(F)C(C)(C)C(N)CC(NCC)C(CCCC(C)C)C(C)C |
| InChI | InChI=1S/C21H43FN2/c1-9-19(22)21(7,8)20(23)14-18(24-10-2)17(16(5)6)13-11-12-15(3)4/h9,15-20,24H,1,10-14,23H2,2-8H3 |
| InChIKey | HGUMPTZOLSSIIB-UHFFFAOYSA-N |
| XLogP | 5.33 |
| TPSA | 38.05 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 13 |
| Heavy Atoms | 24 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 342.59 |
| LogP ≤ 5 | 5.33 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|