C13H12O — CID 91353615
tricyclo[7.3.1.02,7]trideca-2,4,6,9-tetraen-13-one (PubChem CID 91353615) has the molecular formula C13H12O and a molecular weight of 184.24 g/mol. Its IUPAC name is tricyclo[7.3.1.02,7]trideca-2,4,6,9-tetraen-13-one.
| Compound Name | tricyclo[7.3.1.02,7]trideca-2,4,6,9-tetraen-13-one |
|---|---|
| PubChem CID | 91353615 |
| Molecular Formula | C13H12O |
| Molecular Weight | 184.24 g/mol |
| Exact Mass | 184.09 |
| IUPAC Name | tricyclo[7.3.1.02,7]trideca-2,4,6,9-tetraen-13-one |
| SMILES | O=C1C2=CCCC1c1ccccc1C2 |
| InChI | InChI=1S/C13H12O/c14-13-10-5-3-7-12(13)11-6-2-1-4-9(11)8-10/h1-2,4-6,12H,3,7-8H2 |
| InChIKey | UMJMSLVFNUISGG-UHFFFAOYSA-N |
| XLogP | 2.62 |
| TPSA | 17.07 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | |
| Heavy Atoms | 14 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 184.24 |
| LogP ≤ 5 | 2.62 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 1 |