C6H11BrO4 — CID 91353742
(2R,3S,5S)-3-bromo-6-methyloxane-2,4,5-triol (PubChem CID 91353742) has the molecular formula C6H11BrO4 and a molecular weight of 227.05 g/mol. Its IUPAC name is (2R,3S,5S)-3-bromo-6-methyloxane-2,4,5-triol.
| Compound Name | (2R,3S,5S)-3-bromo-6-methyloxane-2,4,5-triol |
|---|---|
| PubChem CID | 91353742 |
| Molecular Formula | C6H11BrO4 |
| Molecular Weight | 227.05 g/mol |
| Exact Mass | 225.98 |
| IUPAC Name | (2R,3S,5S)-3-bromo-6-methyloxane-2,4,5-triol |
| SMILES | CC1O[C@@H](O)[C@@H](Br)C(O)[C@@H]1O |
| InChI | InChI=1S/C6H11BrO4/c1-2-4(8)5(9)3(7)6(10)11-2/h2-6,8-10H,1H3/t2?,3-,4+,5?,6+/m0/s1 |
| InChIKey | WCCJMIBXGLUWRG-NNGXUUBWSA-N |
| XLogP | -0.79 |
| TPSA | 69.92 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | |
| Heavy Atoms | 11 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 227.05 |
| LogP ≤ 5 | -0.79 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'alkyl_halide', 'substructure': 'N/A'} |
|---|