C9H13N5O5S — CID 91353752
[7-(aminomethyl)-1-methyl-9-oxo-4,5,8,10-tetrazatricyclo[6.2.1.02,6]undeca-2(6),3-dien-10-yl] hydrogen sulfate (PubChem CID 91353752) has the molecular formula C9H13N5O5S and a molecular weight of 303.30 g/mol. Its IUPAC name is [7-(aminomethyl)-1-methyl-9-oxo-4,5,8,10-tetrazatricyclo[6.2.1.02,6]undeca-2(6),3-dien-10-yl] hydrogen sulfate.
| Compound Name | [7-(aminomethyl)-1-methyl-9-oxo-4,5,8,10-tetrazatricyclo[6.2.1.02,6]undeca-2(6),3-dien-10-yl] hydrogen sulfate |
|---|---|
| PubChem CID | 91353752 |
| Molecular Formula | C9H13N5O5S |
| Molecular Weight | 303.30 g/mol |
| Exact Mass | 303.06 |
| IUPAC Name | [7-(aminomethyl)-1-methyl-9-oxo-4,5,8,10-tetrazatricyclo[6.2.1.02,6]undeca-2(6),3-dien-10-yl] hydrogen sulfate |
| SMILES | CC12CN(C(=O)N1OS(=O)(=O)O)C(CN)c1[nH]ncc12 |
| InChI | InChI=1S/C9H13N5O5S/c1-9-4-13(8(15)14(9)19-20(16,17)18)6(2-10)7-5(9)3-11-12-7/h3,6H,2,4,10H2,1H3,(H,11,12)(H,16,17,18) |
| InChIKey | QOODBVKRJXWKAI-UHFFFAOYSA-N |
| XLogP | -0.89 |
| TPSA | 141.85 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 303.30 |
| LogP ≤ 5 | -0.89 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'Sulfonic_acid_2', 'substructure': 'N/A'} |
|---|