C21H24N4O10S — CID 91354317
2-(2-amino-5-hydroxy-1,3-thiazol-4-yl)-N-[4-[2-[(1,1-dihydroxy-2-phenylethyl)amino]-2,2-dihydroxyethyl]-2,3,5,6-tetrahydroxyphenyl]acetamide (PubChem CID 91354317) has the molecular formula C21H24N4O10S and a molecular weight of 524.51 g/mol. Its IUPAC name is 2-(2-amino-5-hydroxy-1,3-thiazol-4-yl)-N-[4-[2-[(1,1-dihydroxy-2-phenylethyl)amino]-2,2-dihydroxyethyl]-2,3,5,6-tetrahydroxyphenyl]acetamide.
| Compound Name | 2-(2-amino-5-hydroxy-1,3-thiazol-4-yl)-N-[4-[2-[(1,1-dihydroxy-2-phenylethyl)amino]-2,2-dihydroxyethyl]-2,3,5,6-tetrahydroxyphenyl]acetamide |
|---|---|
| PubChem CID | 91354317 |
| Molecular Formula | C21H24N4O10S |
| Molecular Weight | 524.51 g/mol |
| Exact Mass | 524.12 |
| IUPAC Name | 2-(2-amino-5-hydroxy-1,3-thiazol-4-yl)-N-[4-[2-[(1,1-dihydroxy-2-phenylethyl)amino]-2,2-dihydroxyethyl]-2,3,5,6-tetrahydroxyphenyl]acetamide |
| SMILES | Nc1nc(CC(=O)Nc2c(O)c(O)c(CC(O)(O)NC(O)(O)Cc3ccccc3)c(O)c2O)c(O)s1 |
| InChI | InChI=1S/C21H24N4O10S/c22-19-23-11(18(31)36-19)6-12(26)24-13-16(29)14(27)10(15(28)17(13)30)8-21(34,35)25-20(32,33)7-9-4-2-1-3-5-9/h1-5,25,27-35H,6-8H2,(H2,22,23)(H,24,26) |
| InChIKey | JJOQFTPDXQFBQL-UHFFFAOYSA-N |
| XLogP | -0.91 |
| TPSA | 262.11 Ų |
| H-Bond Donors | 12 |
| H-Bond Acceptors | 14 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 36 |
| Complexity | — |
3 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 524.51 |
| LogP ≤ 5 | -0.91 |
| H-Bond Donors ≤ 5 | 12 |
| H-Bond Acceptors ≤ 10 | 14 |
| Structural Alerts | {'alert_name': 'catechol_A(92)', 'substructure': 'N/A'}, {'alert_name': 'catechol', 'substructure': 'N/A'}, {'alert_name': 'het-C-het_not_in_ring', 'substructure': 'N/A'}, {'alert_name': 'hydroquinone', 'substructure': 'N/A'} |
|---|