ethyl 2-[methyl(1,3-thiazol-5-yl)amino]acetate

C8H12N2O2S — CID 91354380

IUPACethyl 2-[methyl(1,3-thiazol-5-yl)amino]acetate
SMILESCCOC(=O)CN(C)c1cncs1
InChIInChI=1S/C8H12N2O2S/c1-3-12-8(11)5-10(2)7-4-9-6-13-7/h4,6H,3,5H2,1-2H3
InChIKeySODNDQNTMSIMAF-UHFFFAOYSA-N
MW200.26 g/mol
LogP1.14
Rot. Bonds4

About ethyl 2-[methyl(1,3-thiazol-5-yl)amino]acetate

ethyl 2-[methyl(1,3-thiazol-5-yl)amino]acetate (PubChem CID 91354380) has the molecular formula C8H12N2O2S and a molecular weight of 200.26 g/mol. Its IUPAC name is ethyl 2-[methyl(1,3-thiazol-5-yl)amino]acetate.

Molecular Properties

Compound Nameethyl 2-[methyl(1,3-thiazol-5-yl)amino]acetate
PubChem CID91354380
Molecular FormulaC8H12N2O2S
Molecular Weight200.26 g/mol
Exact Mass200.06
IUPAC Nameethyl 2-[methyl(1,3-thiazol-5-yl)amino]acetate
SMILESCCOC(=O)CN(C)c1cncs1
InChIInChI=1S/C8H12N2O2S/c1-3-12-8(11)5-10(2)7-4-9-6-13-7/h4,6H,3,5H2,1-2H3
InChIKeySODNDQNTMSIMAF-UHFFFAOYSA-N
XLogP1.14
TPSA42.43 Ų
H-Bond Donors
H-Bond Acceptors5
Rotatable Bonds4
Heavy Atoms13
Complexity—

Lipinski Rule of Five

Passes Rule of Five

RuleValue
MW ≤ 500200.26
LogP ≤ 51.14
H-Bond Donors ≤ 50
H-Bond Acceptors ≤ 105

Analyze ethyl 2-[methyl(1,3-thiazol-5-yl)amino]acetate with MolForge

Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.

Launch Full Analysis

Frequently Asked Questions

What is the IUPAC name of ethyl 2-[methyl(1,3-thiazol-5-yl)amino]acetate?
The IUPAC name of ethyl 2-[methyl(1,3-thiazol-5-yl)amino]acetate (CID 91354380) is ethyl 2-[methyl(1,3-thiazol-5-yl)amino]acetate.
What is the SMILES notation for ethyl 2-[methyl(1,3-thiazol-5-yl)amino]acetate?
The canonical SMILES for ethyl 2-[methyl(1,3-thiazol-5-yl)amino]acetate is CCOC(=O)CN(C)c1cncs1.
What is the InChIKey of ethyl 2-[methyl(1,3-thiazol-5-yl)amino]acetate?
The InChIKey is SODNDQNTMSIMAF-UHFFFAOYSA-N. The full InChI is InChI=1S/C8H12N2O2S/c1-3-12-8(11)5-10(2)7-4-9-6-13-7/h4,6H,3,5H2,1-2H3.
What are the key properties of ethyl 2-[methyl(1,3-thiazol-5-yl)amino]acetate?
ethyl 2-[methyl(1,3-thiazol-5-yl)amino]acetate has a molecular weight of 200.26 g/mol, XLogP of 1.14, 4 rotatable bonds, 0 hydrogen bond donors, and 5 hydrogen bond acceptors.
Where does this data come from?
All data for ethyl 2-[methyl(1,3-thiazol-5-yl)amino]acetate is sourced from PubChem (CID 91354380), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).