C26H28O5S — CID 91354524
(2S,3S,4S,5R,6R)-3,4-dibenzyl-6-(hydroxymethyl)-2-phenylsulfanyloxane-3,4,5-triol (PubChem CID 91354524) has the molecular formula C26H28O5S and a molecular weight of 452.57 g/mol. Its IUPAC name is (2S,3S,4S,5R,6R)-3,4-dibenzyl-6-(hydroxymethyl)-2-phenylsulfanyloxane-3,4,5-triol.
| Compound Name | (2S,3S,4S,5R,6R)-3,4-dibenzyl-6-(hydroxymethyl)-2-phenylsulfanyloxane-3,4,5-triol |
|---|---|
| PubChem CID | 91354524 |
| Molecular Formula | C26H28O5S |
| Molecular Weight | 452.57 g/mol |
| Exact Mass | 452.17 |
| IUPAC Name | (2S,3S,4S,5R,6R)-3,4-dibenzyl-6-(hydroxymethyl)-2-phenylsulfanyloxane-3,4,5-triol |
| SMILES | OC[C@H]1O[C@@H](Sc2ccccc2)[C@](O)(Cc2ccccc2)[C@](O)(Cc2ccccc2)[C@@H]1O |
| InChI | InChI=1S/C26H28O5S/c27-18-22-23(28)25(29,16-19-10-4-1-5-11-19)26(30,17-20-12-6-2-7-13-20)24(31-22)32-21-14-8-3-9-15-21/h1-15,22-24,27-30H,16-18H2/t22-,23-,24+,25+,26-/m1/s1 |
| InChIKey | CPROVTDPBXAINF-PUHDZGQXSA-N |
| XLogP | 2.80 |
| TPSA | 90.15 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 32 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 452.57 |
| LogP ≤ 5 | 2.80 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 6 |