About CID 91355583
CID 91355583 (PubChem CID 91355583) has the molecular formula C37H66
and a molecular weight of 510.94 g/mol.
Molecular Properties
| Compound Name | CID 91355583 |
| PubChem CID | 91355583 |
| Molecular Formula | C37H66 |
| Molecular Weight | 510.94 g/mol |
| Exact Mass | 510.52 |
| IUPAC Name | — |
| SMILES | CCCC1=C(C)C2(CC2C)C2(C)C(C)CC2(C)C(CC)(CCC)CCC(CCC)CCCC2(CC2)C1C |
| InChI | InChI=1S/C37H66/c1-11-16-31-18-15-21-35(23-24-35)29(7)32(17-12-2)30(8)37(26-28(37)6)34(10)27(5)25-33(34,9)36(14-4,20-13-3)22-19-31/h27-29,31H,11-26H2,1-10H3 |
| InChIKey | JCAJQWOREXQBOL-UHFFFAOYSA-N |
| XLogP | 12.17 |
| TPSA | 0.00 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | |
| Rotatable Bonds | 7 |
| Heavy Atoms | 37 |
| Complexity | — |
Lipinski Rule of Five
2 violations
| Rule | Value |
| MW ≤ 500 | 510.94 |
| LogP ≤ 5 | 12.17 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 0 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|
Analyze CID 91355583 with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of CID 91355583?
The IUPAC name of CID 91355583 (CID 91355583) is not available.
What is the SMILES notation for CID 91355583?
The canonical SMILES for CID 91355583 is CCCC1=C(C)C2(CC2C)C2(C)C(C)CC2(C)C(CC)(CCC)CCC(CCC)CCCC2(CC2)C1C.
What is the InChIKey of CID 91355583?
The InChIKey is JCAJQWOREXQBOL-UHFFFAOYSA-N. The full InChI is InChI=1S/C37H66/c1-11-16-31-18-15-21-35(23-24-35)29(7)32(17-12-2)30(8)37(26-28(37)6)34(10)27(5)25-33(34,9)36(14-4,20-13-3)22-19-31/h27-29,31H,11-26H2,1-10H3.
What are the key properties of CID 91355583?
CID 91355583 has a molecular weight of 510.94 g/mol, XLogP of 12.17, 7 rotatable bonds, 0 hydrogen bond donors, and 0 hydrogen bond acceptors.
Where does this data come from?
All data for CID 91355583 is sourced from PubChem (CID 91355583), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).