C13H18O6 — CID 91355814
methyl 2-[(3aS,4R,5S,6aS)-6-formyl-4-hydroxy-3a,6a-dimethyl-3-oxo-1,4,5,6-tetrahydrocyclopenta[c]furan-5-yl]acetate (PubChem CID 91355814) has the molecular formula C13H18O6 and a molecular weight of 270.28 g/mol. Its IUPAC name is methyl 2-[(3aS,4R,5S,6aS)-6-formyl-4-hydroxy-3a,6a-dimethyl-3-oxo-1,4,5,6-tetrahydrocyclopenta[c]furan-5-yl]acetate.
| Compound Name | methyl 2-[(3aS,4R,5S,6aS)-6-formyl-4-hydroxy-3a,6a-dimethyl-3-oxo-1,4,5,6-tetrahydrocyclopenta[c]furan-5-yl]acetate |
|---|---|
| PubChem CID | 91355814 |
| Molecular Formula | C13H18O6 |
| Molecular Weight | 270.28 g/mol |
| Exact Mass | 270.11 |
| IUPAC Name | methyl 2-[(3aS,4R,5S,6aS)-6-formyl-4-hydroxy-3a,6a-dimethyl-3-oxo-1,4,5,6-tetrahydrocyclopenta[c]furan-5-yl]acetate |
| SMILES | COC(=O)C[C@H]1C(C=O)[C@]2(C)COC(=O)[C@]2(C)[C@@H]1O |
| InChI | InChI=1S/C13H18O6/c1-12-6-19-11(17)13(12,2)10(16)7(8(12)5-14)4-9(15)18-3/h5,7-8,10,16H,4,6H2,1-3H3/t7-,8?,10+,12-,13-/m0/s1 |
| InChIKey | LQYBWZUTIHRWQW-RIJOJWSVSA-N |
| XLogP | -0.08 |
| TPSA | 89.90 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 270.28 |
| LogP ≤ 5 | -0.08 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'aldehyde', 'substructure': 'N/A'} |
|---|