C9H14N2O2S — CID 91356292
1-[3-(aminomethyl)phenyl]ethanesulfonamide (PubChem CID 91356292) has the molecular formula C9H14N2O2S and a molecular weight of 214.29 g/mol. Its IUPAC name is 1-[3-(aminomethyl)phenyl]ethanesulfonamide.
| Compound Name | 1-[3-(aminomethyl)phenyl]ethanesulfonamide |
|---|---|
| PubChem CID | 91356292 |
| Molecular Formula | C9H14N2O2S |
| Molecular Weight | 214.29 g/mol |
| Exact Mass | 214.08 |
| IUPAC Name | 1-[3-(aminomethyl)phenyl]ethanesulfonamide |
| SMILES | CC(c1cccc(CN)c1)S(N)(=O)=O |
| InChI | InChI=1S/C9H14N2O2S/c1-7(14(11,12)13)9-4-2-3-8(5-9)6-10/h2-5,7H,6,10H2,1H3,(H2,11,12,13) |
| InChIKey | ZYBQLZPIXLUFQH-UHFFFAOYSA-N |
| XLogP | 0.49 |
| TPSA | 86.18 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 14 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 214.29 |
| LogP ≤ 5 | 0.49 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |