About 4-(4-hydroxy-4-phenylpiperidin-1-yl)-N,N-dimethyl-2,2-diphenylbutanamide
4-(4-hydroxy-4-phenylpiperidin-1-yl)-N,N-dimethyl-2,2-diphenylbutanamide (PubChem CID 91356446) has the molecular formula C58H68N4O4
and a molecular weight of 885.21 g/mol. Its IUPAC name is 4-(4-hydroxy-4-phenylpiperidin-1-yl)-N,N-dimethyl-2,2-diphenylbutanamide.
Molecular Properties
| Compound Name | 4-(4-hydroxy-4-phenylpiperidin-1-yl)-N,N-dimethyl-2,2-diphenylbutanamide |
| PubChem CID | 91356446 |
| Molecular Formula | C58H68N4O4 |
| Molecular Weight | 885.21 g/mol |
| Exact Mass | 884.52 |
| IUPAC Name | 4-(4-hydroxy-4-phenylpiperidin-1-yl)-N,N-dimethyl-2,2-diphenylbutanamide |
| SMILES | CN(C)C(=O)C(CCN1CCC(O)(c2ccccc2)CC1)(c1ccccc1)c1ccccc1.CN(C)C(=O)C(CCN1CCC(O)(c2ccccc2)CC1)(c1ccccc1)c1ccccc1 |
| InChI | InChI=1S/2C29H34N2O2/c2*1-30(2)27(32)29(25-14-8-4-9-15-25,26-16-10-5-11-17-26)20-23-31-21-18-28(33,19-22-31)24-12-6-3-7-13-24/h2*3-17,33H,18-23H2,1-2H3 |
| InChIKey | BTSKCSCXSZWQEF-UHFFFAOYSA-N |
| XLogP | 8.87 |
| TPSA | 87.56 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 14 |
| Heavy Atoms | 66 |
| Complexity | — |
Lipinski Rule of Five
2 violations
| Rule | Value |
| MW ≤ 500 | 885.21 |
| LogP ≤ 5 | 8.87 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |
Analyze 4-(4-hydroxy-4-phenylpiperidin-1-yl)-N,N-dimethyl-2,2-diphenylbutanamide with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 4-(4-hydroxy-4-phenylpiperidin-1-yl)-N,N-dimethyl-2,2-diphenylbutanamide?
The IUPAC name of 4-(4-hydroxy-4-phenylpiperidin-1-yl)-N,N-dimethyl-2,2-diphenylbutanamide (CID 91356446) is 4-(4-hydroxy-4-phenylpiperidin-1-yl)-N,N-dimethyl-2,2-diphenylbutanamide.
What is the SMILES notation for 4-(4-hydroxy-4-phenylpiperidin-1-yl)-N,N-dimethyl-2,2-diphenylbutanamide?
The canonical SMILES for 4-(4-hydroxy-4-phenylpiperidin-1-yl)-N,N-dimethyl-2,2-diphenylbutanamide is CN(C)C(=O)C(CCN1CCC(O)(c2ccccc2)CC1)(c1ccccc1)c1ccccc1.CN(C)C(=O)C(CCN1CCC(O)(c2ccccc2)CC1)(c1ccccc1)c1ccccc1.
What is the InChIKey of 4-(4-hydroxy-4-phenylpiperidin-1-yl)-N,N-dimethyl-2,2-diphenylbutanamide?
The InChIKey is BTSKCSCXSZWQEF-UHFFFAOYSA-N. The full InChI is InChI=1S/2C29H34N2O2/c2*1-30(2)27(32)29(25-14-8-4-9-15-25,26-16-10-5-11-17-26)20-23-31-21-18-28(33,19-22-31)24-12-6-3-7-13-24/h2*3-17,33H,18-23H2,1-2H3.
What are the key properties of 4-(4-hydroxy-4-phenylpiperidin-1-yl)-N,N-dimethyl-2,2-diphenylbutanamide?
4-(4-hydroxy-4-phenylpiperidin-1-yl)-N,N-dimethyl-2,2-diphenylbutanamide has a molecular weight of 885.21 g/mol, XLogP of 8.87, 14 rotatable bonds, 2 hydrogen bond donors, and 6 hydrogen bond acceptors.
Where does this data come from?
All data for 4-(4-hydroxy-4-phenylpiperidin-1-yl)-N,N-dimethyl-2,2-diphenylbutanamide is sourced from PubChem (CID 91356446), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).