C20H15ClFNO4 — CID 91356448
methyl 4-[5-chloro-2-[(4-fluorophenyl)methyl]-1H-indol-3-yl]-2,4-dioxobutanoate (PubChem CID 91356448) has the molecular formula C20H15ClFNO4 and a molecular weight of 387.79 g/mol. Its IUPAC name is methyl 4-[5-chloro-2-[(4-fluorophenyl)methyl]-1H-indol-3-yl]-2,4-dioxobutanoate.
| Compound Name | methyl 4-[5-chloro-2-[(4-fluorophenyl)methyl]-1H-indol-3-yl]-2,4-dioxobutanoate |
|---|---|
| PubChem CID | 91356448 |
| Molecular Formula | C20H15ClFNO4 |
| Molecular Weight | 387.79 g/mol |
| Exact Mass | 387.07 |
| IUPAC Name | methyl 4-[5-chloro-2-[(4-fluorophenyl)methyl]-1H-indol-3-yl]-2,4-dioxobutanoate |
| SMILES | COC(=O)C(=O)CC(=O)c1c(Cc2ccc(F)cc2)[nH]c2ccc(Cl)cc12 |
| InChI | InChI=1S/C20H15ClFNO4/c1-27-20(26)18(25)10-17(24)19-14-9-12(21)4-7-15(14)23-16(19)8-11-2-5-13(22)6-3-11/h2-7,9,23H,8,10H2,1H3 |
| InChIKey | HAOBNPFSZCXXGS-UHFFFAOYSA-N |
| XLogP | 3.87 |
| TPSA | 76.23 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 27 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 387.79 |
| LogP ≤ 5 | 3.87 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'beta-keto/anhydride', 'substructure': 'N/A'}, {'alert_name': 'diketo_group', 'substructure': 'N/A'} |
|---|