C14H24N2O6 — CID 91356468
1,4-dihydroxy-1,4-bis[(2-methylpyrrolidin-1-yl)oxy]butane-2,3-dione (PubChem CID 91356468) has the molecular formula C14H24N2O6 and a molecular weight of 316.35 g/mol. Its IUPAC name is 1,4-dihydroxy-1,4-bis[(2-methylpyrrolidin-1-yl)oxy]butane-2,3-dione.
| Compound Name | 1,4-dihydroxy-1,4-bis[(2-methylpyrrolidin-1-yl)oxy]butane-2,3-dione |
|---|---|
| PubChem CID | 91356468 |
| Molecular Formula | C14H24N2O6 |
| Molecular Weight | 316.35 g/mol |
| Exact Mass | 316.16 |
| IUPAC Name | 1,4-dihydroxy-1,4-bis[(2-methylpyrrolidin-1-yl)oxy]butane-2,3-dione |
| SMILES | CC1CCCN1OC(O)C(=O)C(=O)C(O)ON1CCCC1C |
| InChI | InChI=1S/C14H24N2O6/c1-9-5-3-7-15(9)21-13(19)11(17)12(18)14(20)22-16-8-4-6-10(16)2/h9-10,13-14,19-20H,3-8H2,1-2H3 |
| InChIKey | YFRXSDNJWOGDCA-UHFFFAOYSA-N |
| XLogP | -0.41 |
| TPSA | 99.54 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 316.35 |
| LogP ≤ 5 | -0.41 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'imine_one_A(321)', 'substructure': 'N/A'}, {'alert_name': 'diketo_group', 'substructure': 'N/A'}, {'alert_name': 'het-C-het_not_in_ring', 'substructure': 'N/A'} |
|---|