C31H44O5 — CID 91356540
(1R,7R,11S,15S,17R)-11-hydroxy-7-[(1R)-1-hydroxy-3-(4-methyl-3,6-dihydro-2H-pyran-2-yl)prop-2-enyl]-15-methyl-13-methylidene-21-oxabicyclo[15.3.1]henicosa-3,9,19-trien-5-one (PubChem CID 91356540) has the molecular formula C31H44O5 and a molecular weight of 496.69 g/mol. Its IUPAC name is (1R,7R,11S,15S,17R)-11-hydroxy-7-[(1R)-1-hydroxy-3-(4-methyl-3,6-dihydro-2H-pyran-2-yl)prop-2-enyl]-15-methyl-13-methylidene-21-oxabicyclo[15.3.1]henicosa-3,9,19-trien-5-one.
| Compound Name | (1R,7R,11S,15S,17R)-11-hydroxy-7-[(1R)-1-hydroxy-3-(4-methyl-3,6-dihydro-2H-pyran-2-yl)prop-2-enyl]-15-methyl-13-methylidene-21-oxabicyclo[15.3.1]henicosa-3,9,19-trien-5-one |
|---|---|
| PubChem CID | 91356540 |
| Molecular Formula | C31H44O5 |
| Molecular Weight | 496.69 g/mol |
| Exact Mass | 496.32 |
| IUPAC Name | (1R,7R,11S,15S,17R)-11-hydroxy-7-[(1R)-1-hydroxy-3-(4-methyl-3,6-dihydro-2H-pyran-2-yl)prop-2-enyl]-15-methyl-13-methylidene-21-oxabicyclo[15.3.1]henicosa-3,9,19-trien-5-one |
| SMILES | C=C1C[C@H](C)C[C@@H]2CC=C[C@@H](CC=CC(=O)C[C@H]([C@@H](O)C=CC3CC(C)=CCO3)CC=C[C@@H](O)C1)O2 |
| InChI | InChI=1S/C31H44O5/c1-22-15-16-35-29(19-22)13-14-31(34)25-7-4-8-26(32)18-23(2)17-24(3)20-30-12-6-11-28(36-30)10-5-9-27(33)21-25/h4-6,8-9,11,13-15,24-26,28-32,34H,2,7,10,12,16-21H2,1,3H3/t24-,25+,26+,28+,29?,30-,31-/m0/s1 |
| InChIKey | PUVCLABJDGVXJV-KXLSZNHMSA-N |
| XLogP | 5.56 |
| TPSA | 75.99 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 36 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 496.69 |
| LogP ≤ 5 | 5.56 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|