C23H46O2Si — CID 91356569
(3S)-3-[(2R,3R,6R)-6-[tert-butyl(dimethyl)silyl]oxy-3,7-dimethyloctan-2-yl]-3-methylcyclohexan-1-one (PubChem CID 91356569) has the molecular formula C23H46O2Si and a molecular weight of 382.71 g/mol. Its IUPAC name is (3S)-3-[(2R,3R,6R)-6-[tert-butyl(dimethyl)silyl]oxy-3,7-dimethyloctan-2-yl]-3-methylcyclohexan-1-one.
| Compound Name | (3S)-3-[(2R,3R,6R)-6-[tert-butyl(dimethyl)silyl]oxy-3,7-dimethyloctan-2-yl]-3-methylcyclohexan-1-one |
|---|---|
| PubChem CID | 91356569 |
| Molecular Formula | C23H46O2Si |
| Molecular Weight | 382.71 g/mol |
| Exact Mass | 382.33 |
| IUPAC Name | (3S)-3-[(2R,3R,6R)-6-[tert-butyl(dimethyl)silyl]oxy-3,7-dimethyloctan-2-yl]-3-methylcyclohexan-1-one |
| SMILES | CC(C)[C@@H](CC[C@@H](C)[C@@H](C)[C@@]1(C)CCCC(=O)C1)O[Si](C)(C)C(C)(C)C |
| InChI | InChI=1S/C23H46O2Si/c1-17(2)21(25-26(9,10)22(5,6)7)14-13-18(3)19(4)23(8)15-11-12-20(24)16-23/h17-19,21H,11-16H2,1-10H3/t18-,19-,21-,23+/m1/s1 |
| InChIKey | MNUPUXHHLMTUAR-ZNTQHIFFSA-N |
| XLogP | 7.23 |
| TPSA | 26.30 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 26 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 382.71 |
| LogP ≤ 5 | 7.23 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'} |
|---|