About 9-bromopurine
9-bromopurine (PubChem CID 91356605) has the molecular formula C5H3BrN4
and a molecular weight of 199.01 g/mol. Its IUPAC name is 9-bromopurine.
Molecular Properties
| Compound Name | 9-bromopurine |
| PubChem CID | 91356605 |
| Molecular Formula | C5H3BrN4 |
| Molecular Weight | 199.01 g/mol |
| Exact Mass | 197.95 |
| IUPAC Name | 9-bromopurine |
| SMILES | Brn1cnc2cncnc21 |
| InChI | InChI=1S/C5H3BrN4/c6-10-3-9-4-1-7-2-8-5(4)10/h1-3H |
| InChIKey | RIDRVWIEDYVCEP-UHFFFAOYSA-N |
| XLogP | 0.98 |
| TPSA | 43.60 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | |
| Heavy Atoms | 10 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 199.01 |
| LogP ≤ 5 | 0.98 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
Analyze 9-bromopurine with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 9-bromopurine?
The IUPAC name of 9-bromopurine (CID 91356605) is 9-bromopurine.
What is the SMILES notation for 9-bromopurine?
The canonical SMILES for 9-bromopurine is Brn1cnc2cncnc21.
What is the InChIKey of 9-bromopurine?
The InChIKey is RIDRVWIEDYVCEP-UHFFFAOYSA-N. The full InChI is InChI=1S/C5H3BrN4/c6-10-3-9-4-1-7-2-8-5(4)10/h1-3H.
What are the key properties of 9-bromopurine?
9-bromopurine has a molecular weight of 199.01 g/mol, XLogP of 0.98, 0 rotatable bonds, 0 hydrogen bond donors, and 4 hydrogen bond acceptors.
Where does this data come from?
All data for 9-bromopurine is sourced from PubChem (CID 91356605), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).