C20H23FO3S — CID 91356751
2-[2-(4-fluorophenyl)ethylsulfanyl]-3-[4-(3-hydroxypropyl)phenyl]propanoic acid (PubChem CID 91356751) has the molecular formula C20H23FO3S and a molecular weight of 362.47 g/mol. Its IUPAC name is 2-[2-(4-fluorophenyl)ethylsulfanyl]-3-[4-(3-hydroxypropyl)phenyl]propanoic acid.
| Compound Name | 2-[2-(4-fluorophenyl)ethylsulfanyl]-3-[4-(3-hydroxypropyl)phenyl]propanoic acid |
|---|---|
| PubChem CID | 91356751 |
| Molecular Formula | C20H23FO3S |
| Molecular Weight | 362.47 g/mol |
| Exact Mass | 362.14 |
| IUPAC Name | 2-[2-(4-fluorophenyl)ethylsulfanyl]-3-[4-(3-hydroxypropyl)phenyl]propanoic acid |
| SMILES | O=C(O)C(Cc1ccc(CCCO)cc1)SCCc1ccc(F)cc1 |
| InChI | InChI=1S/C20H23FO3S/c21-18-9-7-16(8-10-18)11-13-25-19(20(23)24)14-17-5-3-15(4-6-17)2-1-12-22/h3-10,19,22H,1-2,11-14H2,(H,23,24) |
| InChIKey | FLYFVQFRCRTEFZ-UHFFFAOYSA-N |
| XLogP | 3.72 |
| TPSA | 57.53 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 362.47 |
| LogP ≤ 5 | 3.72 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |