About 2-[2-(dimethylamino)ethoxy]ethyl-dimethylazanium;(Z)-4-(2-hydroxyethoxy)-4-oxobut-2-enoate
2-[2-(dimethylamino)ethoxy]ethyl-dimethylazanium;(Z)-4-(2-hydroxyethoxy)-4-oxobut-2-enoate (PubChem CID 91357115) has the molecular formula C14H28N2O6
and a molecular weight of 320.39 g/mol. Its IUPAC name is 2-[2-(dimethylamino)ethoxy]ethyl-dimethylazanium;(Z)-4-(2-hydroxyethoxy)-4-oxobut-2-enoate.
Molecular Properties
| Compound Name | 2-[2-(dimethylamino)ethoxy]ethyl-dimethylazanium;(Z)-4-(2-hydroxyethoxy)-4-oxobut-2-enoate |
| PubChem CID | 91357115 |
| Molecular Formula | C14H28N2O6 |
| Molecular Weight | 320.39 g/mol |
| Exact Mass | 320.19 |
| IUPAC Name | 2-[2-(dimethylamino)ethoxy]ethyl-dimethylazanium;(Z)-4-(2-hydroxyethoxy)-4-oxobut-2-enoate |
| SMILES | CN(C)CCOCC[NH+](C)C.O=C([O-])/C=C\C(=O)OCCO |
| InChI | InChI=1S/C8H20N2O.C6H8O5/c1-9(2)5-7-11-8-6-10(3)4;7-3-4-11-6(10)2-1-5(8)9/h5-8H2,1-4H3;1-2,7H,3-4H2,(H,8,9)/b;2-1- |
| InChIKey | PVAKPRSUDSJVIB-BTJKTKAUSA-N |
| XLogP | -3.46 |
| TPSA | 103.57 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 22 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 320.39 |
| LogP ≤ 5 | -3.46 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 7 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|
Analyze 2-[2-(dimethylamino)ethoxy]ethyl-dimethylazanium;(Z)-4-(2-hydroxyethoxy)-4-oxobut-2-enoate with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 2-[2-(dimethylamino)ethoxy]ethyl-dimethylazanium;(Z)-4-(2-hydroxyethoxy)-4-oxobut-2-enoate?
The IUPAC name of 2-[2-(dimethylamino)ethoxy]ethyl-dimethylazanium;(Z)-4-(2-hydroxyethoxy)-4-oxobut-2-enoate (CID 91357115) is 2-[2-(dimethylamino)ethoxy]ethyl-dimethylazanium;(Z)-4-(2-hydroxyethoxy)-4-oxobut-2-enoate.
What is the SMILES notation for 2-[2-(dimethylamino)ethoxy]ethyl-dimethylazanium;(Z)-4-(2-hydroxyethoxy)-4-oxobut-2-enoate?
The canonical SMILES for 2-[2-(dimethylamino)ethoxy]ethyl-dimethylazanium;(Z)-4-(2-hydroxyethoxy)-4-oxobut-2-enoate is CN(C)CCOCC[NH+](C)C.O=C([O-])/C=C\C(=O)OCCO.
What is the InChIKey of 2-[2-(dimethylamino)ethoxy]ethyl-dimethylazanium;(Z)-4-(2-hydroxyethoxy)-4-oxobut-2-enoate?
The InChIKey is PVAKPRSUDSJVIB-BTJKTKAUSA-N. The full InChI is InChI=1S/C8H20N2O.C6H8O5/c1-9(2)5-7-11-8-6-10(3)4;7-3-4-11-6(10)2-1-5(8)9/h5-8H2,1-4H3;1-2,7H,3-4H2,(H,8,9)/b;2-1-.
What are the key properties of 2-[2-(dimethylamino)ethoxy]ethyl-dimethylazanium;(Z)-4-(2-hydroxyethoxy)-4-oxobut-2-enoate?
2-[2-(dimethylamino)ethoxy]ethyl-dimethylazanium;(Z)-4-(2-hydroxyethoxy)-4-oxobut-2-enoate has a molecular weight of 320.39 g/mol, XLogP of -3.46, 10 rotatable bonds, 2 hydrogen bond donors, and 7 hydrogen bond acceptors.
Where does this data come from?
All data for 2-[2-(dimethylamino)ethoxy]ethyl-dimethylazanium;(Z)-4-(2-hydroxyethoxy)-4-oxobut-2-enoate is sourced from PubChem (CID 91357115), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).