C20H19N3S — CID 9135716
3-[[(2R)-2-(1,3-benzothiazol-2-yl)piperidin-1-yl]methyl]benzonitrile (PubChem CID 9135716) has the molecular formula C20H19N3S and a molecular weight of 333.46 g/mol. Its IUPAC name is 3-[[(2R)-2-(1,3-benzothiazol-2-yl)piperidin-1-yl]methyl]benzonitrile.
| Compound Name | 3-[[(2R)-2-(1,3-benzothiazol-2-yl)piperidin-1-yl]methyl]benzonitrile |
|---|---|
| PubChem CID | 9135716 |
| Molecular Formula | C20H19N3S |
| Molecular Weight | 333.46 g/mol |
| Exact Mass | 333.13 |
| IUPAC Name | 3-[[(2R)-2-(1,3-benzothiazol-2-yl)piperidin-1-yl]methyl]benzonitrile |
| SMILES | N#Cc1cccc(CN2CCCC[C@@H]2c2nc3ccccc3s2)c1 |
| InChI | InChI=1S/C20H19N3S/c21-13-15-6-5-7-16(12-15)14-23-11-4-3-9-18(23)20-22-17-8-1-2-10-19(17)24-20/h1-2,5-8,10,12,18H,3-4,9,11,14H2/t18-/m1/s1 |
| InChIKey | YQFRVONYPFWYRL-GOSISDBHSA-N |
| XLogP | 4.90 |
| TPSA | 39.92 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 333.46 |
| LogP ≤ 5 | 4.90 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |