C10H16O2 — CID 91357304
4a-hydroxy-2,3,4,5,6,7,8,8a-octahydronaphthalen-1-one (PubChem CID 91357304) has the molecular formula C10H16O2 and a molecular weight of 168.24 g/mol. Its IUPAC name is 4a-hydroxy-2,3,4,5,6,7,8,8a-octahydronaphthalen-1-one.
| Compound Name | 4a-hydroxy-2,3,4,5,6,7,8,8a-octahydronaphthalen-1-one |
|---|---|
| PubChem CID | 91357304 |
| Molecular Formula | C10H16O2 |
| Molecular Weight | 168.24 g/mol |
| Exact Mass | 168.12 |
| IUPAC Name | 4a-hydroxy-2,3,4,5,6,7,8,8a-octahydronaphthalen-1-one |
| SMILES | O=C1CCCC2(O)CCCCC12 |
| InChI | InChI=1S/C10H16O2/c11-9-5-3-7-10(12)6-2-1-4-8(9)10/h8,12H,1-7H2 |
| InChIKey | ACPBKLXVRRPRFF-UHFFFAOYSA-N |
| XLogP | 1.66 |
| TPSA | 37.30 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | |
| Heavy Atoms | 12 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 168.24 |
| LogP ≤ 5 | 1.66 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |