C18H44F2N4O+2 — CID 91357358
3-(2-fluoroethylamino)propyl-trimethylazanium;fluoromethane;trimethyl-[3-(propanoylamino)propyl]azanium (PubChem CID 91357358) has the molecular formula C18H44F2N4O+2 and a molecular weight of 370.57 g/mol. Its IUPAC name is 3-(2-fluoroethylamino)propyl-trimethylazanium;fluoromethane;trimethyl-[3-(propanoylamino)propyl]azanium.
| Compound Name | 3-(2-fluoroethylamino)propyl-trimethylazanium;fluoromethane;trimethyl-[3-(propanoylamino)propyl]azanium |
|---|---|
| PubChem CID | 91357358 |
| Molecular Formula | C18H44F2N4O+2 |
| Molecular Weight | 370.57 g/mol |
| Exact Mass | 370.35 |
| IUPAC Name | 3-(2-fluoroethylamino)propyl-trimethylazanium;fluoromethane;trimethyl-[3-(propanoylamino)propyl]azanium |
| SMILES | CCC(=O)NCCC[N+](C)(C)C.CF.C[N+](C)(C)CCCNCCF |
| InChI | InChI=1S/C9H20N2O.C8H20FN2.CH3F/c1-5-9(12)10-7-6-8-11(2,3)4;1-11(2,3)8-4-6-10-7-5-9;1-2/h5-8H2,1-4H3;10H,4-8H2,1-3H3;1H3/q;+1;/p+1 |
| InChIKey | YWPGPTXGIZKLTE-UHFFFAOYSA-O |
| XLogP | 1.84 |
| TPSA | 41.13 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 11 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 370.57 |
| LogP ≤ 5 | 1.84 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'quaternary_nitrogen_2', 'substructure': 'N/A'} |
|---|