C31H60O5 — CID 91357477
(2S,3S)-12-[(2R,3S,5R)-3-hydroxy-5-[(1R)-1-hydroxydec-9-enyl]-2-pentyloxolan-2-yl]dodecane-2,3-diol (PubChem CID 91357477) has the molecular formula C31H60O5 and a molecular weight of 512.82 g/mol. Its IUPAC name is (2S,3S)-12-[(2R,3S,5R)-3-hydroxy-5-[(1R)-1-hydroxydec-9-enyl]-2-pentyloxolan-2-yl]dodecane-2,3-diol.
| Compound Name | (2S,3S)-12-[(2R,3S,5R)-3-hydroxy-5-[(1R)-1-hydroxydec-9-enyl]-2-pentyloxolan-2-yl]dodecane-2,3-diol |
|---|---|
| PubChem CID | 91357477 |
| Molecular Formula | C31H60O5 |
| Molecular Weight | 512.82 g/mol |
| Exact Mass | 512.44 |
| IUPAC Name | (2S,3S)-12-[(2R,3S,5R)-3-hydroxy-5-[(1R)-1-hydroxydec-9-enyl]-2-pentyloxolan-2-yl]dodecane-2,3-diol |
| SMILES | C=CCCCCCCC[C@@H](O)[C@H]1C[C@H](O)[C@@](CCCCC)(CCCCCCCCC[C@H](O)[C@H](C)O)O1 |
| InChI | InChI=1S/C31H60O5/c1-4-6-8-9-11-15-18-22-28(34)29-25-30(35)31(36-29,23-19-7-5-2)24-20-16-13-10-12-14-17-21-27(33)26(3)32/h4,26-30,32-35H,1,5-25H2,2-3H3/t26-,27-,28+,29+,30-,31+/m0/s1 |
| InChIKey | JDZTVWHSYRYFDA-XEGIUAKZSA-N |
| XLogP | 6.99 |
| TPSA | 90.15 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 24 |
| Heavy Atoms | 36 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 512.82 |
| LogP ≤ 5 | 6.99 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|