About 5-[3-(3,4-dichlorophenyl)butan-2-yl]-4-methyl-2-(oxolan-3-yloxy)pyridine
5-[3-(3,4-dichlorophenyl)butan-2-yl]-4-methyl-2-(oxolan-3-yloxy)pyridine (PubChem CID 91357552) has the molecular formula C20H23Cl2NO2
and a molecular weight of 380.32 g/mol. Its IUPAC name is 5-[3-(3,4-dichlorophenyl)butan-2-yl]-4-methyl-2-(oxolan-3-yloxy)pyridine.
Molecular Properties
| Compound Name | 5-[3-(3,4-dichlorophenyl)butan-2-yl]-4-methyl-2-(oxolan-3-yloxy)pyridine |
| PubChem CID | 91357552 |
| Molecular Formula | C20H23Cl2NO2 |
| Molecular Weight | 380.32 g/mol |
| Exact Mass | 379.11 |
| IUPAC Name | 5-[3-(3,4-dichlorophenyl)butan-2-yl]-4-methyl-2-(oxolan-3-yloxy)pyridine |
| SMILES | Cc1cc(OC2CCOC2)ncc1C(C)C(C)c1ccc(Cl)c(Cl)c1 |
| InChI | InChI=1S/C20H23Cl2NO2/c1-12-8-20(25-16-6-7-24-11-16)23-10-17(12)14(3)13(2)15-4-5-18(21)19(22)9-15/h4-5,8-10,13-14,16H,6-7,11H2,1-3H3 |
| InChIKey | MNXJYQCCARKUNN-UHFFFAOYSA-N |
| XLogP | 5.77 |
| TPSA | 31.35 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 25 |
| Complexity | — |
Lipinski Rule of Five
1 violation
| Rule | Value |
| MW ≤ 500 | 380.32 |
| LogP ≤ 5 | 5.77 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
Analyze 5-[3-(3,4-dichlorophenyl)butan-2-yl]-4-methyl-2-(oxolan-3-yloxy)pyridine with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 5-[3-(3,4-dichlorophenyl)butan-2-yl]-4-methyl-2-(oxolan-3-yloxy)pyridine?
The IUPAC name of 5-[3-(3,4-dichlorophenyl)butan-2-yl]-4-methyl-2-(oxolan-3-yloxy)pyridine (CID 91357552) is 5-[3-(3,4-dichlorophenyl)butan-2-yl]-4-methyl-2-(oxolan-3-yloxy)pyridine.
What is the SMILES notation for 5-[3-(3,4-dichlorophenyl)butan-2-yl]-4-methyl-2-(oxolan-3-yloxy)pyridine?
The canonical SMILES for 5-[3-(3,4-dichlorophenyl)butan-2-yl]-4-methyl-2-(oxolan-3-yloxy)pyridine is Cc1cc(OC2CCOC2)ncc1C(C)C(C)c1ccc(Cl)c(Cl)c1.
What is the InChIKey of 5-[3-(3,4-dichlorophenyl)butan-2-yl]-4-methyl-2-(oxolan-3-yloxy)pyridine?
The InChIKey is MNXJYQCCARKUNN-UHFFFAOYSA-N. The full InChI is InChI=1S/C20H23Cl2NO2/c1-12-8-20(25-16-6-7-24-11-16)23-10-17(12)14(3)13(2)15-4-5-18(21)19(22)9-15/h4-5,8-10,13-14,16H,6-7,11H2,1-3H3.
What are the key properties of 5-[3-(3,4-dichlorophenyl)butan-2-yl]-4-methyl-2-(oxolan-3-yloxy)pyridine?
5-[3-(3,4-dichlorophenyl)butan-2-yl]-4-methyl-2-(oxolan-3-yloxy)pyridine has a molecular weight of 380.32 g/mol, XLogP of 5.77, 5 rotatable bonds, 0 hydrogen bond donors, and 3 hydrogen bond acceptors.
Where does this data come from?
All data for 5-[3-(3,4-dichlorophenyl)butan-2-yl]-4-methyl-2-(oxolan-3-yloxy)pyridine is sourced from PubChem (CID 91357552), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).