C20H34O2 — CID 91357657
(4aS,5S,8aS)-4,4,7,8a-tetramethyl-8-(3-methylpent-3-enyl)-1,2,3,4a,5,6-hexahydronaphthalene-1,5-diol (PubChem CID 91357657) has the molecular formula C20H34O2 and a molecular weight of 306.49 g/mol. Its IUPAC name is (4aS,5S,8aS)-4,4,7,8a-tetramethyl-8-(3-methylpent-3-enyl)-1,2,3,4a,5,6-hexahydronaphthalene-1,5-diol.
| Compound Name | (4aS,5S,8aS)-4,4,7,8a-tetramethyl-8-(3-methylpent-3-enyl)-1,2,3,4a,5,6-hexahydronaphthalene-1,5-diol |
|---|---|
| PubChem CID | 91357657 |
| Molecular Formula | C20H34O2 |
| Molecular Weight | 306.49 g/mol |
| Exact Mass | 306.26 |
| IUPAC Name | (4aS,5S,8aS)-4,4,7,8a-tetramethyl-8-(3-methylpent-3-enyl)-1,2,3,4a,5,6-hexahydronaphthalene-1,5-diol |
| SMILES | CC=C(C)CCC1=C(C)C[C@H](O)[C@H]2C(C)(C)CCC(O)[C@]12C |
| InChI | InChI=1S/C20H34O2/c1-7-13(2)8-9-15-14(3)12-16(21)18-19(4,5)11-10-17(22)20(15,18)6/h7,16-18,21-22H,8-12H2,1-6H3/t16-,17?,18-,20-/m0/s1 |
| InChIKey | UMBZCWVTZLJKDW-OLOOMHLZSA-N |
| XLogP | 4.62 |
| TPSA | 40.46 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 306.49 |
| LogP ≤ 5 | 4.62 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|